The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-{[(3,5-dimethoxy-4-methylbenzoyl)(2-phenylethyl)amino]methyl}phenoxy)acetic acid ID: ALA3981813
PubChem CID: 66774954
Max Phase: Preclinical
Molecular Formula: C27H29NO6
Molecular Weight: 463.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)N(CCc2ccccc2)Cc2ccc(OCC(=O)O)cc2)cc(OC)c1C
Standard InChI: InChI=1S/C27H29NO6/c1-19-24(32-2)15-22(16-25(19)33-3)27(31)28(14-13-20-7-5-4-6-8-20)17-21-9-11-23(12-10-21)34-18-26(29)30/h4-12,15-16H,13-14,17-18H2,1-3H3,(H,29,30)
Standard InChI Key: FDORZHLISAVKJL-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
26.4624 -10.0910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4612 -10.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1693 -11.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8789 -10.9101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8761 -10.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1675 -9.6822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5823 -9.6762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2915 -10.0821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5792 -8.8590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9977 -9.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7069 -10.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4131 -9.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1691 -12.1367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4613 -12.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7546 -9.6826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0470 -10.0914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7532 -11.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2946 -10.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0038 -11.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0053 -12.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7137 -12.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4208 -12.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4151 -11.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7061 -10.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1183 -10.0732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8240 -9.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8214 -8.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1072 -8.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4044 -8.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1306 -12.5223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1348 -13.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8446 -13.7444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8487 -14.5616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5502 -13.3322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
3 13 1 0
13 14 1 0
1 15 1 0
15 16 1 0
2 17 1 0
8 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
12 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 12 1 0
22 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.53Molecular Weight (Monoisotopic): 463.1995AlogP: 4.36#Rotatable Bonds: 11Polar Surface Area: 85.30Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.55CX Basic pKa: ┄CX LogP: 4.53CX LogD: 1.17Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -0.86
References 1. Terakado M, Suzuki H, Hashimura K, Tanaka M, Ueda H, Kohno H, Fujimoto T, Saga H, Nakade S, Habashita H, Takaoka Y, Seko T.. (2016) Discovery of ONO-7300243 from a Novel Class of Lysophosphatidic Acid Receptor 1 Antagonists: From Hit to Lead., 7 (10): [PMID:27774128 ] [10.1021/acsmedchemlett.6b00225 ]