(4-{[(3,5-dimethoxy-4-methylbenzoyl)(2-phenylethyl)amino]methyl}phenoxy)acetic acid

ID: ALA3981813

PubChem CID: 66774954

Max Phase: Preclinical

Molecular Formula: C27H29NO6

Molecular Weight: 463.53

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)N(CCc2ccccc2)Cc2ccc(OCC(=O)O)cc2)cc(OC)c1C

Standard InChI:  InChI=1S/C27H29NO6/c1-19-24(32-2)15-22(16-25(19)33-3)27(31)28(14-13-20-7-5-4-6-8-20)17-21-9-11-23(12-10-21)34-18-26(29)30/h4-12,15-16H,13-14,17-18H2,1-3H3,(H,29,30)

Standard InChI Key:  FDORZHLISAVKJL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   26.4624  -10.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4612  -10.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1693  -11.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8789  -10.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8761  -10.0874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1675   -9.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5823   -9.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2915  -10.0821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5792   -8.8590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9977   -9.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7069  -10.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4131   -9.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1691  -12.1367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4613  -12.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7546   -9.6826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0470  -10.0914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7532  -11.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2946  -10.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0038  -11.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0053  -12.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7137  -12.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4208  -12.1173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4151  -11.2959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7061  -10.8937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1183  -10.0732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8240   -9.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8214   -8.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1072   -8.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4044   -8.8517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1306  -12.5223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1348  -13.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8446  -13.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8487  -14.5616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5502  -13.3322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
  3 13  1  0
 13 14  1  0
  1 15  1  0
 15 16  1  0
  2 17  1  0
  8 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 12 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 12  1  0
 22 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA3981813

   2-[4-[[(3,5-Dimethoxy-4-methylbenzoyl)-(2-phenylethyl)amino]methyl]phenoxy]acetic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 463.53

Molecular Weight (Monoisotopic): 463.1995

AlogP: 4.36

#Rotatable Bonds: 11

Polar Surface Area: 85.30

Molecular Species: ACID

HBA: 5

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 1

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 3.55

CX Basic pKa: ┄

CX LogP: 4.53

CX LogD: 1.17

Aromatic Rings: 3

Heavy Atoms: 34

QED Weighted: 0.45

Np Likeness Score: -0.86

References

1. Terakado M, Suzuki H, Hashimura K, Tanaka M, Ueda H, Kohno H, Fujimoto T, Saga H, Nakade S, Habashita H, Takaoka Y, Seko T..  (2016)  Discovery of ONO-7300243 from a Novel Class of Lysophosphatidic Acid Receptor 1 Antagonists: From Hit to Lead.,  7  (10): [PMID:27774128] [10.1021/acsmedchemlett.6b00225]

Source

Source(1):

• Scientific Literature