US9145380, 128

ID: ALA3981835

PubChem CID: 57751081

Max Phase: Preclinical

Molecular Formula: C18H22N2O4S2

Molecular Weight: 394.52

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccccc1NS(=O)(=O)c1ccc(C2CCCCC2)cc1

Standard InChI:  InChI=1S/C18H22N2O4S2/c19-25(21,22)18-9-5-4-8-17(18)20-26(23,24)16-12-10-15(11-13-16)14-6-2-1-3-7-14/h4-5,8-14,20H,1-3,6-7H2,(H2,19,21,22)

Standard InChI Key:  PEJJOTNQSJUPDC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    2.5984   -2.7004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5988   -1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6384   -0.9011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6377   -2.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421   -3.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3020   -2.5494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0095   -6.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0126   -7.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3132   -8.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6106   -7.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6076   -5.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3162   -9.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0199  -10.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0254  -12.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3272  -12.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6235  -11.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6180  -10.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  2  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  2  0
 12 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 21  1  0
M  END

Alternative Forms

Associated Targets(Human)

PTGES2 Tchem Prostaglandin E synthase 2 (329 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.52Molecular Weight (Monoisotopic): 394.1021AlogP: 3.18#Rotatable Bonds: 5
Polar Surface Area: 106.33Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.83CX Basic pKa: CX LogP: 3.18CX LogD: 2.66
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.81Np Likeness Score: -1.27

References

1.  (2015)  Bis-(sulfonylamino) derivatives for use in therapy, 

Source

Source(1):