US9217012, 4

ID: ALA3982169

PubChem CID: 122198702

Max Phase: Preclinical

Molecular Formula: C20H29F2N4O7P

Molecular Weight: 506.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)NCCCCC(NC(=O)C(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)NC(C)=O)C(N)=O

Standard InChI:  InChI=1S/C20H29F2N4O7P/c1-12(27)24-10-4-3-5-16(18(23)29)26-19(30)17(25-13(2)28)11-14-6-8-15(9-7-14)20(21,22)34(31,32)33/h6-9,16-17H,3-5,10-11H2,1-2H3,(H2,23,29)(H,24,27)(H,25,28)(H,26,30)(H2,31,32,33)

Standard InChI Key:  WNWRSXVTZWXJTI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 34  0  0  0  0  0  0  0  0999 V2000
   10.1179  -12.1744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0776  -12.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0759  -13.9726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7794  -12.0195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7815  -10.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4833   -9.7656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4855   -8.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1873   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894   -6.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9336   -3.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5986    0.3004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5998    3.0012    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6390    3.6012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5607    3.6016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6000    4.2012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2925   -3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0048   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0464   -3.5909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0007   -1.7949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4889   -5.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4893   -4.0601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5282   -5.8601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
 24 25  2  0
 24 26  1  0
 24 27  1  0
 13 28  1  0
 28 29  1  0
 29 30  2  0
 29 31  1  0
  9 32  1  0
 32 33  2  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3982169

    ---

Associated Targets(Human)

PTPN2 Tchem T-cell protein-tyrosine phosphatase (1317 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN1 Tchem Protein-tyrosine phosphatase 1B (8528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.44Molecular Weight (Monoisotopic): 506.1742AlogP: 0.24#Rotatable Bonds: 13
Polar Surface Area: 187.92Molecular Species: ACIDHBA: 5HBD: 6
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 0.49CX Basic pKa: CX LogP: -1.32CX LogD: -4.08
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.16Np Likeness Score: -0.22

References

1.  (2015)  Inhibitors of protein tyrosine phosphatases, 

Source

Source(1):