The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9173869, 47 ID: ALA3982206
PubChem CID: 16722767
Max Phase: Preclinical
Molecular Formula: C25H32N2O4
Molecular Weight: 424.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCN(CCC(=O)NC1CCCc2ccccc21)C(=O)c1cc(OC)cc(OC)c1
Standard InChI: InChI=1S/C25H32N2O4/c1-4-13-27(25(29)19-15-20(30-2)17-21(16-19)31-3)14-12-24(28)26-23-11-7-9-18-8-5-6-10-22(18)23/h5-6,8,10,15-17,23H,4,7,9,11-14H2,1-3H3,(H,26,28)
Standard InChI Key: ROZUQMUUSMFXPX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
6.4999 -4.9403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5003 -3.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7998 -2.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 0.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0990 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0969 0.4636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4003 -1.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6994 -0.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9984 -1.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2997 -0.7364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3381 -1.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9985 -2.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6994 -3.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6964 -5.2350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6563 -5.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4004 -2.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 10 1 0
19 14 1 0
4 20 1 0
20 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 2 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 2 0
31 22 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.54Molecular Weight (Monoisotopic): 424.2362AlogP: 4.14#Rotatable Bonds: 9Polar Surface Area: 67.87Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.95CX Basic pKa: ┄CX LogP: 3.68CX LogD: 3.68Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.17
References 1. (2015) Mediators of hedgehog signaling pathways, compositions and uses related thereto,