The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(4-(4-isopropoxyphenylsulfonyl)piperazin-1-yl)-2-(phenylcarbamoyl)phenoxy)acetic acid ID: ALA3982208
PubChem CID: 134157343
Max Phase: Preclinical
Molecular Formula: C28H31N3O7S
Molecular Weight: 553.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)Oc1ccc(S(=O)(=O)N2CCN(c3ccc(C(=O)Nc4ccccc4)c(OCC(=O)O)c3)CC2)cc1
Standard InChI: InChI=1S/C28H31N3O7S/c1-20(2)38-23-9-11-24(12-10-23)39(35,36)31-16-14-30(15-17-31)22-8-13-25(26(18-22)37-19-27(32)33)28(34)29-21-6-4-3-5-7-21/h3-13,18,20H,14-17,19H2,1-2H3,(H,29,34)(H,32,33)
Standard InChI Key: BEXZZKBRANZIJB-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
22.5677 -0.3632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9804 -1.0731 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.3888 -0.3607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7445 -2.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7433 -3.5352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4514 -3.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1610 -3.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1582 -2.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4496 -2.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8618 -2.3009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5709 -2.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2750 -2.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2761 -1.4837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5670 -1.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8568 -1.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4512 -4.7614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7433 -5.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7431 -5.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0353 -6.3954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4508 -6.3958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6915 -1.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6875 -2.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3944 -2.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1031 -2.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1005 -1.4784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3930 -1.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8113 -2.7075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5185 -2.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2268 -2.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5174 -1.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0338 -3.9447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3262 -3.5360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0337 -4.7619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6184 -3.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9149 -3.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2076 -3.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2070 -4.7582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9196 -5.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6240 -4.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 10 1 0
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
13 2 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
5 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.64Molecular Weight (Monoisotopic): 553.1883AlogP: 3.70#Rotatable Bonds: 10Polar Surface Area: 125.48Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.52CX Basic pKa: ┄CX LogP: 3.79CX LogD: 0.42Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.39Np Likeness Score: -1.76
References 1. (2012) Sulfonamide derivative having PGD2 receptor antagonistic activity,