The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340510, 3.049 ID: ALA3982397
PubChem CID: 118940393
Max Phase: Preclinical
Molecular Formula: C27H33FN2O3
Molecular Weight: 452.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)[C@H]1C[C@H](F)C1)c1ccc(CN2Cc3ccc(OCC4CC4)cc3C(O)C2)cc1
Standard InChI: InChI=1S/C27H33FN2O3/c1-17(29-27(32)22-10-23(28)11-22)20-6-4-18(5-7-20)13-30-14-21-8-9-24(33-16-19-2-3-19)12-25(21)26(31)15-30/h4-9,12,17,19,22-23,26,31H,2-3,10-11,13-16H2,1H3,(H,29,32)/t17-,22-,23-,26?/m0/s1
Standard InChI Key: AYZKIOGHSCJKTD-QLOUQQAKSA-N
Molfile:
RDKit 2D
33 37 0 0 1 0 0 0 0 0999 V2000
1.5352 -8.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5775 -7.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8732 -8.2623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8660 -9.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8237 -10.3578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1616 -10.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5003 -11.9447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9505 -11.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9877 -12.1649 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.5671 -10.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8864 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1984 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 0.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7984 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2192 1.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4692 2.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 2 0
6 4 1 1
6 7 1 0
7 8 1 0
8 9 1 6
8 10 1 0
10 6 1 0
2 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 25 1 0
22 28 2 0
28 29 1 0
29 30 2 0
30 20 1 0
30 31 1 0
31 16 1 0
14 32 1 0
32 33 2 0
33 11 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.57Molecular Weight (Monoisotopic): 452.2475AlogP: 4.45#Rotatable Bonds: 8Polar Surface Area: 61.80Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.97CX Basic pKa: 7.32CX LogP: 3.47CX LogD: 3.21Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.62Np Likeness Score: -0.81
References 1. (2016) Tetrahydroisoquinoline derivatives, pharmaceutical compositions and uses thereof,