US9340510, 11.000

ID: ALA3982455

PubChem CID: 118940146

Max Phase: Preclinical

Molecular Formula: C24H29FN2O2

Molecular Weight: 396.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](C)c1ccc(CN2Cc3ccc(OCC4CC4)cc3[C@@H](F)C2)cc1

Standard InChI:  InChI=1S/C24H29FN2O2/c1-16(26-17(2)28)20-7-5-18(6-8-20)12-27-13-21-9-10-22(29-15-19-3-4-19)11-23(21)24(25)14-27/h5-11,16,19,24H,3-4,12-15H2,1-2H3,(H,26,28)/t16-,24-/m0/s1

Standard InChI Key:  IARDWWJSSAAAQI-FYSMJZIKSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  1  0  0  0  0  0999 V2000
    1.5352   -8.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5775   -7.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8732   -8.2623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8660   -9.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9019  -10.3687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8237  -10.3578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5847   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8915   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1984    1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971    0.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7984    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2192    1.4475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4692    2.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2935   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2883   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  1
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 21  1  0
 18 24  2  0
 24 25  1  0
 25 26  2  0
 26 16  1  0
 26 27  1  0
 27 12  1  0
 10 28  1  0
 28 29  2  0
 29  7  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3982455

    ---

Associated Targets(Human)

ACACB Tchem Acetyl-CoA carboxylase 2 (3474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.51Molecular Weight (Monoisotopic): 396.2213AlogP: 4.70#Rotatable Bonds: 7
Polar Surface Area: 41.57Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.19CX LogP: 3.64CX LogD: 3.61
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.74Np Likeness Score: -0.98

References

1.  (2016)  Tetrahydroisoquinoline derivatives, pharmaceutical compositions and uses thereof, 

Source

Source(1):