The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Benzhydryl-1-(3,3-diphenylpropionyl)-piperazine-2-carboxylic acid hydrochloride ID: ALA3982680
PubChem CID: 10370073
Max Phase: Preclinical
Molecular Formula: C33H33ClN2O3
Molecular Weight: 504.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=C(O)C1CN(C(c2ccccc2)c2ccccc2)CCN1C(=O)CC(c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C33H32N2O3.ClH/c36-31(23-29(25-13-5-1-6-14-25)26-15-7-2-8-16-26)35-22-21-34(24-30(35)33(37)38)32(27-17-9-3-10-18-27)28-19-11-4-12-20-28;/h1-20,29-30,32H,21-24H2,(H,37,38);1H
Standard InChI Key: HYQGWLLAKFRPTI-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
26.5101 -8.4234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0976 -9.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2685 -9.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8560 -8.4234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2685 -7.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0976 -7.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5101 -9.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0976 -10.5627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3351 -9.8510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3351 -8.4234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7476 -9.1352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7476 -7.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5726 -7.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9851 -8.4234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8101 -8.4234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2226 -9.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8101 -9.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9851 -9.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5726 -9.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9851 -6.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5726 -6.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9851 -5.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8101 -5.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2226 -6.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8101 -6.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0310 -8.4234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6185 -9.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0310 -9.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6185 -10.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7935 -10.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3810 -9.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7935 -9.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6185 -7.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7935 -7.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3810 -6.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7935 -6.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6185 -6.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0310 -6.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6539 -11.5540 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
2 7 1 0
10 11 2 0
10 12 1 0
12 13 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
13 14 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
13 20 1 0
1 10 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
26 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
33 38 2 0
4 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.63Molecular Weight (Monoisotopic): 504.2413AlogP: 5.60#Rotatable Bonds: 8Polar Surface Area: 60.85Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.16CX Basic pKa: 7.56CX LogP: 3.46CX LogD: 3.28Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.34Np Likeness Score: -0.52
References 1. (2004) Calcium channel inhibitors comprising benzhydril spaced from piperazine,