4-Benzhydryl-1-(3,3-diphenylpropionyl)-piperazine-2-carboxylic acid hydrochloride

ID: ALA3982680

PubChem CID: 10370073

Max Phase: Preclinical

Molecular Formula: C33H33ClN2O3

Molecular Weight: 504.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.O=C(O)C1CN(C(c2ccccc2)c2ccccc2)CCN1C(=O)CC(c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C33H32N2O3.ClH/c36-31(23-29(25-13-5-1-6-14-25)26-15-7-2-8-16-26)35-22-21-34(24-30(35)33(37)38)32(27-17-9-3-10-18-27)28-19-11-4-12-20-28;/h1-20,29-30,32H,21-24H2,(H,37,38);1H

Standard InChI Key:  HYQGWLLAKFRPTI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   26.5101   -8.4234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0976   -9.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2685   -9.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8560   -8.4234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2685   -7.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0976   -7.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5101   -9.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0976  -10.5627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3351   -9.8510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3351   -8.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7476   -9.1352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7476   -7.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5726   -7.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9851   -8.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8101   -8.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2226   -9.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8101   -9.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9851   -9.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5726   -9.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9851   -6.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5726   -6.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9851   -5.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8101   -5.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2226   -6.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8101   -6.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0310   -8.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6185   -9.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0310   -9.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6185  -10.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7935  -10.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3810   -9.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7935   -9.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6185   -7.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7935   -7.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3810   -6.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7935   -6.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6185   -6.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0310   -6.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6539  -11.5540    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
 13 14  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 13 20  1  0
  1 10  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 27 32  2  0
 26 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 33 38  2  0
  4 26  1  0
M  END

Associated Targets(Human)

CACNA2D1 Tclin Voltage-dependent L-type calcium channel alpha1C/alpha2delta/beta1b (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA2D1 Tclin Voltage-dependent P/Q-type calcium channel alpha1A/alpha2delta/beta1b (6 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cacna2d2 Voltage-dependent N-type calcium channel alpha1B/alpha2b/beta1b (6 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 504.63Molecular Weight (Monoisotopic): 504.2413AlogP: 5.60#Rotatable Bonds: 8
Polar Surface Area: 60.85Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.16CX Basic pKa: 7.56CX LogP: 3.46CX LogD: 3.28
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.34Np Likeness Score: -0.52

References

1.  (2004)  Calcium channel inhibitors comprising benzhydril spaced from piperazine, 

Source