US9403804, 44

ID: ALA3982733

Max Phase: Preclinical

Molecular Formula: C29H37N5O3

Molecular Weight: 503.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CC=C(c2cc([C@]3(O)CC[C@@H](N4CCOCC4)CC3)ccc2NC(=O)c2nc(C#N)c[nH]2)CC1

Standard InChI:  InChI=1S/C29H37N5O3/c1-28(2)9-5-20(6-10-28)24-17-21(3-4-25(24)33-27(35)26-31-19-22(18-30)32-26)29(36)11-7-23(8-12-29)34-13-15-37-16-14-34/h3-5,17,19,23,36H,6-16H2,1-2H3,(H,31,32)(H,33,35)/t23-,29+

Standard InChI Key:  CYBAEQNTNUTZOY-SIDLAZDFSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  1  0  0  0  0  0999 V2000
    2.3238   -0.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2709   -1.9497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9014    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3042    3.7556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3088    5.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3501    5.8529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0118    6.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1236    7.4927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5903    7.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3424    6.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3406    5.3928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1975    9.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6837   10.2737    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4956    0.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5345    1.3445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1962    0.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1955   -1.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4941   -2.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7935   -1.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7943    0.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4934   -3.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7909   -4.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7878   -5.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4872   -6.7154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1897   -5.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1928   -4.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  2  1  0
  6  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 20 23  1  0
 23 24  3  0
 11 25  1  0
 25 26  1  6
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 25  1  0
 29 32  1  6
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3982733

    ---

Associated Targets(non-human)

Csf1r Macrophage colony-stimulating factor 1 receptor (491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.65Molecular Weight (Monoisotopic): 503.2896AlogP: 4.59#Rotatable Bonds: 5
Polar Surface Area: 114.27Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.22CX Basic pKa: 7.84CX LogP: 3.30CX LogD: 3.36
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.55Np Likeness Score: -0.26

References

1.  (2016)  Inhibitors of c-fms kinase, 

Source

Source(1):