US9475795, 58

ID: ALA3982764

PubChem CID: 72550445

Max Phase: Preclinical

Molecular Formula: C19H26ClN3O3S

Molecular Weight: 411.96

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC1(Cc2ccc(Cl)cc2)CCN(S(=O)(=O)c2c(C)nn(C)c2C)CC1

Standard InChI:  InChI=1S/C19H26ClN3O3S/c1-14-18(15(2)22(3)21-14)27(24,25)23-11-9-19(26-4,10-12-23)13-16-5-7-17(20)8-6-16/h5-8H,9-13H2,1-4H3

Standard InChI Key:  XMEYBUPUTPUUOS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    1.2925   -4.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2945   -3.7533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8590   -2.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1571   -2.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1552   -4.4867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8552   -5.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5571   -4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4540   -5.2388    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.4521   -6.4388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4139   -5.8373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7552   -4.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1053   -5.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3456   -6.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1111   -4.0016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3636   -2.7012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8538   -1.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8958   -3.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0008   -2.2109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
 11  5  1  0
  3 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16  3  1  0
 14 17  1  0
 17 18  2  0
 17 19  2  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 26 20  2  0
 26 27  1  0
M  END

Associated Targets(Human)

PROKR1 Tchem Prokineticin receptor 1 (175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.96Molecular Weight (Monoisotopic): 411.1383AlogP: 3.10#Rotatable Bonds: 5
Polar Surface Area: 64.43Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.16CX LogP: 2.29CX LogD: 2.29
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.76Np Likeness Score: -1.33

References

1.  (2016)  Sulfonyl piperidine derivatives and their use for treating prokineticin mediated diseases, 

Source

Source(1):