US9206167, 2

ID: ALA3982910

PubChem CID: 24963398

Max Phase: Preclinical

Molecular Formula: C23H23N3O2S

Molecular Weight: 405.52

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1[nH]c2ccccc2cc1OCCN1CCN(c2cccc3sccc23)CC1

Standard InChI:  InChI=1S/C23H23N3O2S/c27-23-21(16-17-4-1-2-5-19(17)24-23)28-14-13-25-9-11-26(12-10-25)20-6-3-7-22-18(20)8-15-29-22/h1-8,15-16H,9-14H2,(H,24,27)

Standard InChI Key:  BOKAVZYMEBZBJT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6078   -5.9988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6131   -7.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9147   -8.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2111   -7.4898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2060   -5.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9043   -5.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5134   -8.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8088   -7.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1116   -8.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1191   -9.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8239  -10.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5198  -11.9472    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0288  -12.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4118  -10.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5211   -9.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 11  2  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 15  1  0
 18 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 21  1  0
 29 25  2  0
M  END

Associated Targets(non-human)

Htr2a Serotonin 2a (5-HT2a) receptor (3540 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.52Molecular Weight (Monoisotopic): 405.1511AlogP: 3.94#Rotatable Bonds: 5
Polar Surface Area: 48.57Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.12CX Basic pKa: 7.59CX LogP: 4.10CX LogD: 3.69
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: -1.51

References

1.  (2015)  Piperazine-substituted benzothiophenes for treatment of mental disorders, 

Source

Source(1):