The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9145380, 47 ID: ALA3982964
PubChem CID: 42646764
Max Phase: Preclinical
Molecular Formula: C18H19ClN4O6S2
Molecular Weight: 486.96
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nnc(COc2ccc(NS(=O)(=O)CCc3ccc(Cl)cc3)c(S(N)(=O)=O)c2)o1
Standard InChI: InChI=1S/C18H19ClN4O6S2/c1-12-21-22-18(29-12)11-28-15-6-7-16(17(10-15)31(20,26)27)23-30(24,25)9-8-13-2-4-14(19)5-3-13/h2-7,10,23H,8-9,11H2,1H3,(H2,20,26,27)
Standard InChI Key: MKFMGQFLXZONSO-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
5.9865 -6.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4984 -5.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0312 -5.2378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.5549 3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5568 2.4023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8912 5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1894 6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1895 7.5109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4885 8.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7876 7.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8268 8.1110 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-7.7876 6.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4886 5.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 -1.5004 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6384 -0.9011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5984 -2.7004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6377 -2.1009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2447 -3.1359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2484 -4.2507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 2 0
12 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
20 22 1 0
22 23 2 0
23 17 1 0
10 24 1 0
24 25 2 0
25 7 1 0
24 26 1 0
26 27 2 0
26 28 2 0
26 29 1 0
4 30 2 0
30 31 1 0
31 2 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.96Molecular Weight (Monoisotopic): 486.0435AlogP: 2.24#Rotatable Bonds: 9Polar Surface Area: 154.48Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.94CX Basic pKa: ┄CX LogP: 0.47CX LogD: 0.00Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.91
References 1. (2015) Bis-(sulfonylamino) derivatives for use in therapy,