US9145380, 47

ID: ALA3982964

PubChem CID: 42646764

Max Phase: Preclinical

Molecular Formula: C18H19ClN4O6S2

Molecular Weight: 486.96

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nnc(COc2ccc(NS(=O)(=O)CCc3ccc(Cl)cc3)c(S(N)(=O)=O)c2)o1

Standard InChI:  InChI=1S/C18H19ClN4O6S2/c1-12-21-22-18(29-12)11-28-15-6-7-16(17(10-15)31(20,26)27)23-30(24,25)9-8-13-2-4-14(19)5-3-13/h2-7,10,23H,8-9,11H2,1H3,(H2,20,26,27)

Standard InChI Key:  MKFMGQFLXZONSO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    5.9865   -6.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4984   -5.5497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0312   -5.2378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5973    1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951    3.0039    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5549    3.6021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5568    2.4023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8933    3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8912    5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1894    6.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1895    7.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4885    8.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7876    7.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8268    8.1110    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -7.7876    6.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4886    5.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988   -1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6384   -0.9011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5984   -2.7004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6377   -2.1009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2447   -3.1359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2484   -4.2507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  2  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 23 17  1  0
 10 24  1  0
 24 25  2  0
 25  7  1  0
 24 26  1  0
 26 27  2  0
 26 28  2  0
 26 29  1  0
  4 30  2  0
 30 31  1  0
 31  2  2  0
M  END

Associated Targets(Human)

PTGES2 Tchem Prostaglandin E synthase 2 (329 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.96Molecular Weight (Monoisotopic): 486.0435AlogP: 2.24#Rotatable Bonds: 9
Polar Surface Area: 154.48Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.94CX Basic pKa: CX LogP: 0.47CX LogD: 0.00
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.91

References

1.  (2015)  Bis-(sulfonylamino) derivatives for use in therapy, 

Source

Source(1):