US9340517, 565::US9340517, 580

ID: ALA3983098

PubChem CID: 46897717

Max Phase: Preclinical

Molecular Formula: C34H43ClN4O2

Molecular Weight: 575.20

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@H](CN1CC[C@H](CNC(=O)c2ccc3cc(Cl)ccc3c2)N[C@H](CCN2CCCCC2)C1=O)c1ccccc1

Standard InChI:  InChI=1S/C34H43ClN4O2/c1-2-25(26-9-5-3-6-10-26)24-39-20-15-31(37-32(34(39)41)16-19-38-17-7-4-8-18-38)23-36-33(40)29-12-11-28-22-30(35)14-13-27(28)21-29/h3,5-6,9-14,21-22,25,31-32,37H,2,4,7-8,15-20,23-24H2,1H3,(H,36,40)/t25-,31+,32+/m0/s1

Standard InChI Key:  PLXBZRBLWZSFDH-JYJPFYCCSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  1  0  0  0  0  0999 V2000
    0.6645   -7.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1367   -8.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9732  -10.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4704   -9.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1298   -8.5578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1986   -7.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5374   -5.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9364    1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2403   -5.9299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5691   -7.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0337   -7.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0567   -6.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5195   -6.9678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5436   -5.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0048   -6.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4420   -7.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4180   -8.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9568   -8.4027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6298   -8.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1467   -9.6459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3146  -11.3617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1816  -11.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8371  -12.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9964  -14.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4998  -13.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1553  -12.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  1
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  6
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 16  1  0
 22 23  2  0
 23 13  1  0
  8 24  1  0
 24 25  1  0
 25 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 28  1  0
 25 34  1  0
 34  5  1  0
 34 35  2  0
  3 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
M  END

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 575.20Molecular Weight (Monoisotopic): 574.3075AlogP: 5.85#Rotatable Bonds: 10
Polar Surface Area: 64.68Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.03CX LogP: 5.31CX LogD: 3.67
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.32Np Likeness Score: -0.57

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):