The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340517, 565::US9340517, 580 ID: ALA3983098
PubChem CID: 46897717
Max Phase: Preclinical
Molecular Formula: C34H43ClN4O2
Molecular Weight: 575.20
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H](CN1CC[C@H](CNC(=O)c2ccc3cc(Cl)ccc3c2)N[C@H](CCN2CCCCC2)C1=O)c1ccccc1
Standard InChI: InChI=1S/C34H43ClN4O2/c1-2-25(26-9-5-3-6-10-26)24-39-20-15-31(37-32(34(39)41)16-19-38-17-7-4-8-18-38)23-36-33(40)29-12-11-28-22-30(35)14-13-27(28)21-29/h3,5-6,9-14,21-22,25,31-32,37H,2,4,7-8,15-20,23-24H2,1H3,(H,36,40)/t25-,31+,32+/m0/s1
Standard InChI Key: PLXBZRBLWZSFDH-JYJPFYCCSA-N
Molfile:
RDKit 2D
41 45 0 0 1 0 0 0 0 0999 V2000
0.6645 -7.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1367 -8.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9732 -10.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4704 -9.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1298 -8.5578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1986 -7.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5374 -5.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9364 1.3500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2403 -5.9299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5691 -7.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0337 -7.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0567 -6.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5195 -6.9678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5436 -5.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0048 -6.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4420 -7.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4180 -8.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9568 -8.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6298 -8.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1467 -9.6459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3146 -11.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1816 -11.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8371 -12.8179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9964 -14.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4998 -13.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1553 -12.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 1
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 6
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 16 1 0
22 23 2 0
23 13 1 0
8 24 1 0
24 25 1 0
25 26 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 28 1 0
25 34 1 0
34 5 1 0
34 35 2 0
3 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 575.20Molecular Weight (Monoisotopic): 574.3075AlogP: 5.85#Rotatable Bonds: 10Polar Surface Area: 64.68Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.03CX LogP: 5.31CX LogD: 3.67Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.32Np Likeness Score: -0.57
References 1. (2016) Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor,