US9340517, 435

ID: ALA3983112

PubChem CID: 127054239

Max Phase: Preclinical

Molecular Formula: C36H41ClN4O3

Molecular Weight: 613.20

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccc(Cl)cc1)NC[C@H]1CCN(CC(c2ccccc2)c2ccccc2)C(=O)[C@@H](CC(=O)N2CCCCC2)N1

Standard InChI:  InChI=1S/C36H41ClN4O3/c37-30-17-14-27(15-18-30)16-19-34(42)38-25-31-20-23-41(36(44)33(39-31)24-35(43)40-21-8-3-9-22-40)26-32(28-10-4-1-5-11-28)29-12-6-2-7-13-29/h1-2,4-7,10-19,31-33,39H,3,8-9,20-26H2,(H,38,42)/b19-16+/t31-,33-/m1/s1

Standard InChI Key:  TZSKJJAVKBXXPQ-SLCSACMPSA-N

Molfile:  

     RDKit          2D

 44 48  0  0  1  0  0  0  0  0999 V2000
    8.6199   -9.7180    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.2701   -8.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2942   -7.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8570   -6.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3957   -5.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9554   -4.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4929   -3.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0525   -2.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8702   -1.6155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5900   -2.1568    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1497   -0.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5245    2.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2987    3.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4702    4.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2467    5.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4194    6.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8158    6.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0393    4.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8666    3.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9007    4.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6725    5.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7255    6.0730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8954    5.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6672    3.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2692    3.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8551   -0.6517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4048   -2.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9016   -3.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5758   -2.0274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5555   -4.3709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0513   -4.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7022   -5.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8572   -7.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614   -6.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7106   -5.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3717   -6.7964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8089   -8.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 12 11  1  6
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 17 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 15 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  1  6
 33 34  1  0
 34 35  2  0
 34 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 36  1  0
 32 42  1  0
 42 12  1  0
  5 43  1  0
 43 44  2  0
 44  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3983112

    ---

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 613.20Molecular Weight (Monoisotopic): 612.2867AlogP: 5.26#Rotatable Bonds: 10
Polar Surface Area: 81.75Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.63CX LogP: 4.79CX LogD: 4.72
Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.31Np Likeness Score: -0.41

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):