US9169205, 2.34

ID: ALA3983149

PubChem CID: 118473226

Max Phase: Preclinical

Molecular Formula: C26H29N3O4

Molecular Weight: 447.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)c1ccon1)c1ccc(O[C@@H]2CCN(c3ccc(OCC4CC4)cc3)C2)cc1

Standard InChI:  InChI=1S/C26H29N3O4/c1-18(27-26(30)25-13-15-32-28-25)20-4-8-23(9-5-20)33-24-12-14-29(16-24)21-6-10-22(11-7-21)31-17-19-2-3-19/h4-11,13,15,18-19,24H,2-3,12,14,16-17H2,1H3,(H,27,30)/t18-,24+/m0/s1

Standard InChI Key:  HARDXSBGNUGBDE-MHECFPHRSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  1  0  0  0  0  0999 V2000
    2.5958   -2.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5978   -1.5022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1978   -1.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1958   -2.7065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8504   -1.3796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8541   -0.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1040    1.0342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6368    0.7222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2526    1.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2524    0.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4979   -1.0529    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0317   -0.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1035   -2.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5736   -2.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0739   -4.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0995   -5.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5972   -6.6683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6206   -7.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1183   -9.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8141  -10.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2282  -10.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6247   -4.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1243   -3.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  6  2  0
  2 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 16 15  1  1
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 27  1  0
 24 30  1  0
 30 31  2  0
 31 21  1  0
 14 32  1  0
 32 33  2  0
 33 11  1  0
M  END

Associated Targets(Human)

ACACB Tchem Acetyl-CoA carboxylase 2 (3474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.54Molecular Weight (Monoisotopic): 447.2158AlogP: 4.61#Rotatable Bonds: 9
Polar Surface Area: 76.83Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.17CX Basic pKa: 3.29CX LogP: 4.26CX LogD: 4.26
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -1.42

References

1.  (2015)  Pyrrolidine derivatives, pharmaceutical compositions and uses thereof, 

Source

Source(1):