The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340510, 1.040 ID: ALA3983176
PubChem CID: 118940263
Max Phase: Preclinical
Molecular Formula: C24H31ClN2O2
Molecular Weight: 414.98
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C)Oc1ccc2c(c1Cl)CCN(Cc1ccc(C(C)NC(C)=O)cc1)C2
Standard InChI: InChI=1S/C24H31ClN2O2/c1-5-16(2)29-23-11-10-21-15-27(13-12-22(21)24(23)25)14-19-6-8-20(9-7-19)17(3)26-18(4)28/h6-11,16-17H,5,12-15H2,1-4H3,(H,26,28)
Standard InChI Key: MGJFQPQBPFHKFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
6.2387 -0.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 0.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1984 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 0.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7988 1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0952 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0900 -0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7884 -1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4920 -0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3856 -1.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4280 -0.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3783 -3.0220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.6739 -3.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6680 -4.9796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.7162 -3.1850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
19 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
11 25 1 0
25 26 1 0
26 27 1 0
27 9 1 0
27 28 2 0
28 6 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.98Molecular Weight (Monoisotopic): 414.2074AlogP: 5.27#Rotatable Bonds: 7Polar Surface Area: 41.57Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.99CX LogP: 4.78CX LogD: 4.64Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.01
References 1. (2016) Tetrahydroisoquinoline derivatives, pharmaceutical compositions and uses thereof,