The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,4-dichlorophenyl)-7-{[(1,4-dimethylpiperazin-2-yl)methyl]oxy}-6-(methyloxy)quinazolin-4-amine ID: ALA3983179
PubChem CID: 57802781
Max Phase: Preclinical
Molecular Formula: C22H25Cl2N5O2
Molecular Weight: 462.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cc1OCC1CN(C)CCN1C
Standard InChI: InChI=1S/C22H25Cl2N5O2/c1-28-6-7-29(2)15(11-28)12-31-21-10-19-16(9-20(21)30-3)22(26-13-25-19)27-14-4-5-17(23)18(24)8-14/h4-5,8-10,13,15H,6-7,11-12H2,1-3H3,(H,25,26,27)
Standard InChI Key: JHVXCKPKPWJTHM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
21.3004 -8.7318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0100 -8.3223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0072 -7.4997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2986 -7.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5923 -8.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5946 -7.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8887 -7.0960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1800 -7.5035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1816 -8.3244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8882 -8.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4722 -7.0951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4720 -6.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4749 -8.7347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2951 -6.2772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0010 -5.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7099 -6.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4154 -5.8617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4124 -5.0436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6979 -4.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9954 -5.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1178 -4.6311 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.1247 -6.2676 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.7662 -8.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0595 -8.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3525 -8.3278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6479 -8.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6456 -9.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3542 -9.9612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0650 -9.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3535 -7.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3533 -10.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
8 11 1 0
11 12 1 0
9 13 1 0
4 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
17 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
25 30 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.38Molecular Weight (Monoisotopic): 461.1385AlogP: 4.31#Rotatable Bonds: 6Polar Surface Area: 62.75Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.49CX LogP: 4.28CX LogD: 3.93Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.59Np Likeness Score: -1.01
References 1. (2009) Receptor-type kinase modulators and methods of use,