US9169205, 3.6

ID: ALA3983358

PubChem CID: 118473253

Max Phase: Preclinical

Molecular Formula: C29H35N5O3

Molecular Weight: 501.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)N(C)Cc1ccncn1)c1ccc(OC2CCN(c3ccc(OCC4CC4)cc3)C2)cc1

Standard InChI:  InChI=1S/C29H35N5O3/c1-21(32-29(35)33(2)17-24-13-15-30-20-31-24)23-5-9-27(10-6-23)37-28-14-16-34(18-28)25-7-11-26(12-8-25)36-19-22-3-4-22/h5-13,15,20-22,28H,3-4,14,16-19H2,1-2H3,(H,32,35)/t21-,28?/m0/s1

Standard InChI Key:  MJSUPULSYYTNKB-QDLLFRBVSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  1  0  0  0  0  0999 V2000
    6.2297   -5.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894   -6.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9336   -3.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5548   -3.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1873   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8882   -8.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8881   -9.7618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1871  -10.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1901  -12.0127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4909  -12.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6338  -14.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1021  -14.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8476  -13.2469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8401  -12.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3396  -13.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3101  -14.2222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7849  -13.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2854  -12.5345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7604  -12.2577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2591  -10.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7342  -10.5653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7848   -9.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0584  -11.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3110  -11.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8361  -11.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4862   -9.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4862   -8.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 31  1  0
 28 34  1  0
 34 35  2  0
 35 25  1  0
 18 36  1  0
 36 37  2  0
 37 15  1  0
M  END

Associated Targets(Human)

ACACB Tchem Acetyl-CoA carboxylase 2 (3474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.63Molecular Weight (Monoisotopic): 501.2740AlogP: 4.83#Rotatable Bonds: 10
Polar Surface Area: 79.82Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.30CX LogP: 3.65CX LogD: 3.65
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: -1.58

References

1.  (2015)  Pyrrolidine derivatives, pharmaceutical compositions and uses thereof, 

Source

Source(1):