7-[({4-[(4-butylphenyl)carbonyl]morpholin-2-yl}methyl)oxy]-N-(3,4-dichlorophenyl)-6-(methyloxy)quinazolin-4-amine

ID: ALA3983450

PubChem CID: 57802710

Max Phase: Preclinical

Molecular Formula: C31H32Cl2N4O4

Molecular Weight: 595.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCc1ccc(C(=O)N2CCOC(COc3cc4ncnc(Nc5ccc(Cl)c(Cl)c5)c4cc3OC)C2)cc1

Standard InChI:  InChI=1S/C31H32Cl2N4O4/c1-3-4-5-20-6-8-21(9-7-20)31(38)37-12-13-40-23(17-37)18-41-29-16-27-24(15-28(29)39-2)30(35-19-34-27)36-22-10-11-25(32)26(33)14-22/h6-11,14-16,19,23H,3-5,12-13,17-18H2,1-2H3,(H,34,35,36)

Standard InChI Key:  SYLHDCKBBWIRTH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   37.2449  -18.9328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9569  -18.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9527  -17.7016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2437  -17.2980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5353  -18.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5388  -17.7097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8324  -17.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1258  -17.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1250  -18.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8316  -18.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4168  -17.2989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4168  -16.4777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4201  -18.9360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2437  -16.4767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9466  -16.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6540  -16.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3623  -16.0668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3577  -15.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6470  -14.8441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9416  -15.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7121  -18.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0720  -16.4720    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   33.0047  -18.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0627  -14.8340    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.3001  -18.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5949  -18.9303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5913  -19.7479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2992  -20.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0107  -19.7507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8884  -18.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8908  -17.7025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1795  -18.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4764  -18.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7680  -18.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7652  -19.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4766  -20.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1822  -19.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0568  -20.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3497  -19.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6414  -20.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9343  -19.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  8 11  1  0
 11 12  1  0
  9 13  1  0
  4 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  1  0
 17 22  1  0
 21 23  1  0
 18 24  1  0
 23 25  1  0
 23 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 26 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 35 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
M  END

Associated Targets(Human)

EPHB4 Tchem Ephrin type-B receptor 4 (3198 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EPHA2 Tclin Ephrin type-A receptor 2 (3499 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EGFR Tclin Epidermal growth factor receptor erbB1 (33727 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KDR Tclin Vascular endothelial growth factor receptor 2 (20924 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 595.53Molecular Weight (Monoisotopic): 594.1801AlogP: 6.95#Rotatable Bonds: 10
Polar Surface Area: 85.81Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.62CX LogP: 7.14CX LogD: 7.14
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: -1.17

References

1.  (2009)  Receptor-type kinase modulators and methods of use, 

Source