The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9394285, 188 ID: ALA3983491
PubChem CID: 90421956
Max Phase: Preclinical
Molecular Formula: C23H24ClN3O4
Molecular Weight: 441.92
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(CCCOc2ccc(-c3cc4c(C(=O)O)c[nH]c4cc3Cl)cc2)CC1=O
Standard InChI: InChI=1S/C23H24ClN3O4/c1-26-8-9-27(14-22(26)28)7-2-10-31-16-5-3-15(4-6-16)17-11-18-19(23(29)30)13-25-21(18)12-20(17)24/h3-6,11-13,25H,2,7-10,14H2,1H3,(H,29,30)
Standard InChI Key: VIXDPCATZMZUQX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
12.7105 -10.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6723 -9.7758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3720 -10.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0742 -9.7716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0765 -8.2716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7795 -7.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7840 -6.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4870 -5.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3115 2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.6890 4.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3167 5.2226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8631 3.8342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3769 -7.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6747 -8.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7149 -7.6775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
13 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 18 2 0
22 23 1 0
23 24 2 0
24 16 1 0
24 25 1 0
19 26 1 0
26 27 2 0
26 28 1 0
5 29 1 0
29 30 1 0
30 2 1 0
30 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.92Molecular Weight (Monoisotopic): 441.1455AlogP: 3.73#Rotatable Bonds: 7Polar Surface Area: 85.87Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.52CX Basic pKa: 6.48CX LogP: 0.29CX LogD: -0.39Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -0.75
References 1. (2016) Indole and indazole compounds that activate AMPK,