The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9181249, 139 ID: ALA3983522
PubChem CID: 118159193
Max Phase: Preclinical
Molecular Formula: C26H32F2N6O3
Molecular Weight: 514.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@H]1C[C@@H](Nc2nc3c(nc2N2CCN(Cc4ccc(F)cc4F)CC2)CCN(C(C)=O)C3)C1
Standard InChI: InChI=1S/C26H32F2N6O3/c1-16(35)34-6-5-23-24(15-34)30-25(29-20-12-21(13-20)37-17(2)36)26(31-23)33-9-7-32(8-10-33)14-18-3-4-19(27)11-22(18)28/h3-4,11,20-21H,5-10,12-15H2,1-2H3,(H,29,30)/t20-,21+
Standard InChI Key: JVADGRPSAFEECF-OYRHEFFESA-N
Molfile:
RDKit 2D
37 41 0 0 1 0 0 0 0 0999 V2000
8.2845 -0.9030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2825 0.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3209 0.8985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9812 1.0448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6877 0.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2375 0.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3046 -1.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0102 -7.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3123 -8.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6076 -7.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9104 -8.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9180 -9.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9602 -10.3298 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.6227 -10.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3199 -9.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2837 -10.3535 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3022 5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3422 5.8493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2640 5.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
5 4 1 1
5 6 1 0
6 7 1 0
7 8 1 0
8 5 1 0
7 9 1 1
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 12 2 0
17 18 1 0
18 19 2 0
19 10 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
28 30 1 0
30 31 2 0
31 25 1 0
31 32 1 0
23 33 1 0
33 34 1 0
34 20 1 0
14 35 1 0
35 36 2 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.58Molecular Weight (Monoisotopic): 514.2504AlogP: 2.49#Rotatable Bonds: 6Polar Surface Area: 90.90Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.97CX LogP: 1.30CX LogD: 1.29Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.59Np Likeness Score: -1.08
References 1. (2015) Substituted pyrido[3,4-b]pyrazines as GPR6 modulators, 2. (2018) Tetrahydropyridopyrazines modulators of gpr6, 3. (2016) Tetrahydropyridopyrazines modulators of gpr6,