US9181249, 139

ID: ALA3983522

PubChem CID: 118159193

Max Phase: Preclinical

Molecular Formula: C26H32F2N6O3

Molecular Weight: 514.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@H]1C[C@@H](Nc2nc3c(nc2N2CCN(Cc4ccc(F)cc4F)CC2)CCN(C(C)=O)C3)C1

Standard InChI:  InChI=1S/C26H32F2N6O3/c1-16(35)34-6-5-23-24(15-34)30-25(29-20-12-21(13-20)37-17(2)36)26(31-23)33-9-7-32(8-10-33)14-18-3-4-19(27)11-22(18)28/h3-4,11,20-21H,5-10,12-15H2,1-2H3,(H,29,30)/t20-,21+

Standard InChI Key:  JVADGRPSAFEECF-OYRHEFFESA-N

Molfile:  

     RDKit          2D

 37 41  0  0  1  0  0  0  0  0999 V2000
    8.2845   -0.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2825    0.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3209    0.8985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9812    1.0448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6877    0.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2375    0.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3046   -1.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0102   -7.5017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3123   -8.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6076   -7.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9104   -8.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9180   -9.7351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9602  -10.3298    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6227  -10.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3199   -9.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2837  -10.3535    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3022    5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3422    5.8493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2640    5.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  5  4  1  1
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  5  1  0
  7  9  1  1
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 12  2  0
 17 18  1  0
 18 19  2  0
 19 10  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 28 30  1  0
 30 31  2  0
 31 25  1  0
 31 32  1  0
 23 33  1  0
 33 34  1  0
 34 20  1  0
 14 35  1  0
 35 36  2  0
 35 37  1  0
M  END

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 514.58Molecular Weight (Monoisotopic): 514.2504AlogP: 2.49#Rotatable Bonds: 6
Polar Surface Area: 90.90Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.97CX LogP: 1.30CX LogD: 1.29
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.59Np Likeness Score: -1.08

References

1.  (2015)  Substituted pyrido[3,4-b]pyrazines as GPR6 modulators, 
2.  (2018)  Tetrahydropyridopyrazines modulators of gpr6, 
3.  (2016)  Tetrahydropyridopyrazines modulators of gpr6,