The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9169205, 1.82 ID: ALA3983789
PubChem CID: 118473451
Max Phase: Preclinical
Molecular Formula: C23H25N3O4
Molecular Weight: 407.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](C)c1ccc(OC2CCN(c3cc4c(cc3C#N)OCCO4)C2)cc1
Standard InChI: InChI=1S/C23H25N3O4/c1-15(25-16(2)27)17-3-5-19(6-4-17)30-20-7-8-26(14-20)21-12-23-22(11-18(21)13-24)28-9-10-29-23/h3-6,11-12,15,20H,7-10,14H2,1-2H3,(H,25,27)/t15-,20?/m0/s1
Standard InChI Key: SVPQZVZSORDUBU-OOJLDXBWSA-N
Molfile:
RDKit 2D
30 33 0 0 1 0 0 0 0 0999 V2000
0.0614 -9.3713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2539 -9.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8547 -10.8801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9647 -12.0886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4451 -13.1883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2278 -11.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1438 -8.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6348 -8.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5226 -7.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9195 -5.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8054 -4.6666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2010 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -4.2008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4285 -5.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5407 -6.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
2 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 19 2 0
24 25 1 0
25 26 2 0
26 17 1 0
26 27 1 0
27 28 3 0
10 29 1 0
29 30 2 0
30 7 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.47Molecular Weight (Monoisotopic): 407.1845AlogP: 3.18#Rotatable Bonds: 5Polar Surface Area: 83.82Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.40CX LogD: 2.40Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.82Np Likeness Score: -1.00
References 1. (2015) Pyrrolidine derivatives, pharmaceutical compositions and uses thereof,