US9328118, 36

ID: ALA3983791

PubChem CID: 117914145

Max Phase: Preclinical

Molecular Formula: C20H18F3N7O2

Molecular Weight: 445.41

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cnc2c(-c3ccc(OCC(=O)N4CCNCC4)c(C(F)(F)F)c3)nc(C#N)nc21

Standard InChI:  InChI=1S/C20H18F3N7O2/c1-29-11-26-18-17(27-15(9-24)28-19(18)29)12-2-3-14(13(8-12)20(21,22)23)32-10-16(31)30-6-4-25-5-7-30/h2-3,8,11,25H,4-7,10H2,1H3

Standard InChI Key:  MGQKAAMYGJHUKF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -0.4916   -3.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6380    2.1004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991    0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969    1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945    3.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4946    3.7544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7945    3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0946    3.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0948    4.9540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3945    3.0038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6950    3.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9926    2.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9898    1.4989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6894    0.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3917    1.5038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943    3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5964    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8919    5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9298    5.8556    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8515    5.8513    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8894    6.4533    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  2  1  0
 10  5  1  0
  8 11  1  0
 11 12  3  0
  6 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 21  1  0
 16 27  1  0
 27 28  2  0
 28 13  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
M  END

Associated Targets(Human)

CTSS Tchem Cathepsin S (3285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.41Molecular Weight (Monoisotopic): 445.1474AlogP: 1.73#Rotatable Bonds: 4
Polar Surface Area: 108.96Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.82CX LogP: 1.83CX LogD: 1.27
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -1.27

References

1.  (2016)  Nitrogen-containing bicyclic aromatic heterocyclic compound, 

Source

Source(1):