The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9328118, 36 ID: ALA3983791
PubChem CID: 117914145
Max Phase: Preclinical
Molecular Formula: C20H18F3N7O2
Molecular Weight: 445.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cnc2c(-c3ccc(OCC(=O)N4CCNCC4)c(C(F)(F)F)c3)nc(C#N)nc21
Standard InChI: InChI=1S/C20H18F3N7O2/c1-29-11-26-18-17(27-15(9-24)28-19(18)29)12-2-3-14(13(8-12)20(21,22)23)32-10-16(31)30-6-4-25-5-7-30/h2-3,8,11,25H,4-7,10H2,1H3
Standard InChI Key: MGQKAAMYGJHUKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6380 2.1004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4946 3.7544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7945 3.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0946 3.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0948 4.9540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3945 3.0038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6950 3.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9926 2.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9898 1.4989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6894 0.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3917 1.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5964 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8919 5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9298 5.8556 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8515 5.8513 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8894 6.4533 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 2 1 0
10 5 1 0
8 11 1 0
11 12 3 0
6 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 21 1 0
16 27 1 0
27 28 2 0
28 13 1 0
27 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.41Molecular Weight (Monoisotopic): 445.1474AlogP: 1.73#Rotatable Bonds: 4Polar Surface Area: 108.96Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.82CX LogP: 1.83CX LogD: 1.27Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -1.27
References 1. (2016) Nitrogen-containing bicyclic aromatic heterocyclic compound,