US9169205, 2.29

ID: ALA3983805

PubChem CID: 117885572

Max Phase: Preclinical

Molecular Formula: C24H30N2O4

Molecular Weight: 410.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)CO)c1ccc(O[C@@H]2CCN(c3ccc(OCC4CC4)cc3)C2)cc1

Standard InChI:  InChI=1S/C24H30N2O4/c1-17(25-24(28)15-27)19-4-8-22(9-5-19)30-23-12-13-26(14-23)20-6-10-21(11-7-20)29-16-18-2-3-18/h4-11,17-18,23,27H,2-3,12-16H2,1H3,(H,25,28)/t17-,23+/m0/s1

Standard InChI Key:  TYRRWSQETVUWML-GAJHUEQPSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  1  0  0  0  0  0999 V2000
    2.5958   -2.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5978   -1.5022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1978   -1.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1958   -2.7065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5374   -1.3601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2526    1.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2524    0.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4979   -1.0529    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0317   -0.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1035   -2.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5736   -2.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0739   -4.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0995   -5.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5972   -6.6683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6206   -7.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1183   -9.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8141  -10.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2282  -10.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6247   -4.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1243   -3.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  2  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 13 12  1  1
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 24  1  0
 21 27  1  0
 27 28  2  0
 28 18  1  0
 11 29  1  0
 29 30  2  0
 30  8  1  0
M  END

Associated Targets(Human)

ACACB Tchem Acetyl-CoA carboxylase 2 (3474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.51Molecular Weight (Monoisotopic): 410.2206AlogP: 3.30#Rotatable Bonds: 9
Polar Surface Area: 71.03Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.16CX Basic pKa: 3.29CX LogP: 2.84CX LogD: 2.84
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -0.98

References

1.  (2015)  Pyrrolidine derivatives, pharmaceutical compositions and uses thereof, 

Source

Source(1):