The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[3-(5-(1H-1,2,4-Triazol-3-yl)(1H-Indazol-3-yl))Phenyl]-2-Hydroxy-2-Phenylacetamide ID: ALA3983819
PubChem CID: 22479699
Max Phase: Preclinical
Molecular Formula: C23H18N6O2
Molecular Weight: 410.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(-c2n[nH]c3ccc(-c4nc[nH]n4)cc23)c1)C(O)c1ccccc1
Standard InChI: InChI=1S/C23H18N6O2/c30-21(14-5-2-1-3-6-14)23(31)26-17-8-4-7-15(11-17)20-18-12-16(22-24-13-25-29-22)9-10-19(18)27-28-20/h1-13,21,30H,(H,26,31)(H,27,28)(H,24,25,29)
Standard InChI Key: LATBTIVUYJOACZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
16.0845 -12.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0829 -13.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7939 -13.7244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7912 -12.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5011 -12.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5042 -13.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2909 -13.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7697 -12.8910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2834 -12.2285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5485 -14.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0014 -14.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2585 -15.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0627 -15.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6094 -15.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3495 -14.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3773 -13.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4102 -15.4407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9517 -14.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6924 -14.0537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6327 -13.4033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0886 -14.0122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4995 -14.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2975 -14.5449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7525 -14.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0118 -15.7666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2940 -14.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0952 -14.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6365 -13.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3773 -13.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5719 -12.9957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0341 -13.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 16 1 0
14 17 1 0
17 18 1 0
18 19 2 0
16 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 16 1 0
18 24 1 0
24 25 1 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.44Molecular Weight (Monoisotopic): 410.1491AlogP: 3.69#Rotatable Bonds: 5Polar Surface Area: 119.58Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.50CX Basic pKa: 1.90CX LogP: 3.84CX LogD: 3.84Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: -1.34
References 1. (2002) Indazole derivatives as JNK inhibitors and compositions and methods related thereto,