The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,4-dichlorophenyl)-7-{[(4-ethyl-1,4-oxazepan-2-yl)methyl]oxy}-6-(methyloxy)quinazolin-4-amine ID: ALA3983938
PubChem CID: 57802623
Max Phase: Preclinical
Molecular Formula: C23H26Cl2N4O3
Molecular Weight: 477.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCCOC(COc2cc3ncnc(Nc4ccc(Cl)c(Cl)c4)c3cc2OC)C1
Standard InChI: InChI=1S/C23H26Cl2N4O3/c1-3-29-7-4-8-31-16(12-29)13-32-22-11-20-17(10-21(22)30-2)23(27-14-26-20)28-15-5-6-18(24)19(25)9-15/h5-6,9-11,14,16H,3-4,7-8,12-13H2,1-2H3,(H,26,27,28)
Standard InChI Key: BZLNIUFWAWPNOW-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
8.0685 -15.0877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7781 -14.6783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7753 -13.8556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -13.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3604 -14.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3627 -13.8610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6568 -13.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9481 -13.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9497 -14.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6563 -15.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2403 -13.4510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2401 -12.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2430 -15.0906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0632 -12.6332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7691 -12.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4780 -12.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1835 -12.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1805 -11.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4660 -10.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7635 -11.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8859 -10.9870 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.8928 -12.6235 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.5343 -14.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8276 -15.0940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 -15.9066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2932 -16.4665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1510 -14.6366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4854 -16.3516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3699 -14.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0766 -15.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5391 -17.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9872 -17.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
8 11 1 0
11 12 1 0
9 13 1 0
4 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
17 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
26 28 1 0
27 29 1 0
28 30 1 0
29 30 1 0
26 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.39Molecular Weight (Monoisotopic): 476.1382AlogP: 5.18#Rotatable Bonds: 7Polar Surface Area: 68.74Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.26CX LogP: 4.63CX LogD: 3.72Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.26
References 1. (2009) Receptor-type kinase modulators and methods of use,