The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9169205, 1.11 ID: ALA3983944
PubChem CID: 117885503
Max Phase: Preclinical
Molecular Formula: C24H30N2O3
Molecular Weight: 394.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](C)c1ccc(O[C@@H]2CCN(c3cccc(OCC4CC4)c3)C2)cc1
Standard InChI: InChI=1S/C24H30N2O3/c1-17(25-18(2)27)20-8-10-22(11-9-20)29-24-12-13-26(15-24)21-4-3-5-23(14-21)28-16-19-6-7-19/h3-5,8-11,14,17,19,24H,6-7,12-13,15-16H2,1-2H3,(H,25,27)/t17-,24+/m0/s1
Standard InChI Key: KEWGTVMRROKCTQ-BXKMTCNYSA-N
Molfile:
RDKit 2D
29 32 0 0 1 0 0 0 0 0999 V2000
2.5958 -2.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1978 -1.5065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2382 -0.9086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1958 -2.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2526 1.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2524 0.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4979 -1.0529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0317 -0.7359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1035 -2.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5736 -2.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0739 -4.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0995 -5.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6247 -4.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6473 -6.1176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1721 -5.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1947 -6.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8401 -7.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9805 -8.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1243 -3.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
2 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
12 11 1 1
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 24 1 0
21 27 2 0
27 17 1 0
10 28 1 0
28 29 2 0
29 7 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.52Molecular Weight (Monoisotopic): 394.2256AlogP: 4.33#Rotatable Bonds: 8Polar Surface Area: 50.80Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.72CX LogP: 3.66CX LogD: 3.66Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.72Np Likeness Score: -1.17
References 1. (2015) Pyrrolidine derivatives, pharmaceutical compositions and uses thereof,