The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340517, 219 ID: ALA3983965
PubChem CID: 46896459
Max Phase: Preclinical
Molecular Formula: C33H40N4O2
Molecular Weight: 524.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(/C=C/C(=O)NC[C@@H]2CCN(CC(c3ccccc3)c3ccccc3)C(=O)[C@H](CCCN)N2)cc1
Standard InChI: InChI=1S/C33H40N4O2/c1-25-14-16-26(17-15-25)18-19-32(38)35-23-29-20-22-37(33(39)31(36-29)13-8-21-34)24-30(27-9-4-2-5-10-27)28-11-6-3-7-12-28/h2-7,9-12,14-19,29-31,36H,8,13,20-24,34H2,1H3,(H,35,38)/b19-18+/t29-,31-/m0/s1
Standard InChI Key: RNJAIHODMDSNFG-KKLGXJKSSA-N
Molfile:
RDKit 2D
39 42 0 0 1 0 0 0 0 0999 V2000
8.6199 -9.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2701 -8.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2942 -7.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8570 -6.0391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3957 -5.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9554 -4.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4929 -3.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0525 -2.4938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8702 -1.6155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5900 -2.1568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1497 -0.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5245 2.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2987 3.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4702 4.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2467 5.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4194 6.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8158 6.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0393 4.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8666 3.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9007 4.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6725 5.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7255 6.0730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8954 5.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6672 3.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2692 3.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8551 -0.6517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4048 -2.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9016 -3.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5555 -4.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7523 -4.4589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3717 -6.7964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8089 -8.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
12 11 1 1
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
17 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
15 30 1 0
30 31 2 0
30 32 1 0
32 33 1 1
33 34 1 0
34 35 1 0
35 36 1 0
32 37 1 0
37 12 1 0
5 38 1 0
38 39 2 0
39 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.71Molecular Weight (Monoisotopic): 524.3151AlogP: 4.25#Rotatable Bonds: 11Polar Surface Area: 87.46Molecular Species: BASEHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.90CX LogP: 4.27CX LogD: 1.56Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -0.01
References 1. (2016) Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor,