US9340517, 219

ID: ALA3983965

PubChem CID: 46896459

Max Phase: Preclinical

Molecular Formula: C33H40N4O2

Molecular Weight: 524.71

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(/C=C/C(=O)NC[C@@H]2CCN(CC(c3ccccc3)c3ccccc3)C(=O)[C@H](CCCN)N2)cc1

Standard InChI:  InChI=1S/C33H40N4O2/c1-25-14-16-26(17-15-25)18-19-32(38)35-23-29-20-22-37(33(39)31(36-29)13-8-21-34)24-30(27-9-4-2-5-10-27)28-11-6-3-7-12-28/h2-7,9-12,14-19,29-31,36H,8,13,20-24,34H2,1H3,(H,35,38)/b19-18+/t29-,31-/m0/s1

Standard InChI Key:  RNJAIHODMDSNFG-KKLGXJKSSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  1  0  0  0  0  0999 V2000
    8.6199   -9.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2701   -8.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2942   -7.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8570   -6.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3957   -5.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9554   -4.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4929   -3.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0525   -2.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8702   -1.6155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5900   -2.1568    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1497   -0.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5245    2.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2987    3.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4702    4.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2467    5.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4194    6.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8158    6.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0393    4.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8666    3.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9007    4.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6725    5.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7255    6.0730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8954    5.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6672    3.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2692    3.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8551   -0.6517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4048   -2.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9016   -3.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5555   -4.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7523   -4.4589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3717   -6.7964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8089   -8.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 12 11  1  1
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 17 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 15 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  1  1
 33 34  1  0
 34 35  1  0
 35 36  1  0
 32 37  1  0
 37 12  1  0
  5 38  1  0
 38 39  2  0
 39  2  1  0
M  END

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.71Molecular Weight (Monoisotopic): 524.3151AlogP: 4.25#Rotatable Bonds: 11
Polar Surface Area: 87.46Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.90CX LogP: 4.27CX LogD: 1.56
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -0.01

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):