US9328118, 68

ID: ALA3984006

PubChem CID: 117914115

Max Phase: Preclinical

Molecular Formula: C21H20F3N5O

Molecular Weight: 415.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1nc(-c2ccc(OCCC3CCNCC3)c(C(F)(F)F)c2)c2cc[nH]c2n1

Standard InChI:  InChI=1S/C21H20F3N5O/c22-21(23,24)16-11-14(19-15-5-9-27-20(15)29-18(12-25)28-19)1-2-17(16)30-10-6-13-3-7-26-8-4-13/h1-2,5,9,11,13,26H,3-4,6-8,10H2,(H,27,28,29)

Standard InChI Key:  XLPMIJONDGGFEF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    6.5005    0.4438    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4978   -0.7562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5359   -1.3582    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.5383   -0.1583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -3.7597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4870   -5.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7840   -6.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7795   -7.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0747   -8.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0672   -9.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7644  -10.5165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4691   -9.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4767   -8.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 14  1  0
  7 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 20  1  0
 28 24  2  0
 22 29  1  0
 29 30  3  0
M  END

Associated Targets(Human)

CTSS Tchem Cathepsin S (3285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.42Molecular Weight (Monoisotopic): 415.1620AlogP: 4.28#Rotatable Bonds: 5
Polar Surface Area: 86.62Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.73CX Basic pKa: 10.29CX LogP: 4.20CX LogD: 1.38
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -0.73

References

1.  (2016)  Nitrogen-containing bicyclic aromatic heterocyclic compound, 

Source

Source(1):