The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9328118, 68 ID: ALA3984006
PubChem CID: 117914115
Max Phase: Preclinical
Molecular Formula: C21H20F3N5O
Molecular Weight: 415.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1nc(-c2ccc(OCCC3CCNCC3)c(C(F)(F)F)c2)c2cc[nH]c2n1
Standard InChI: InChI=1S/C21H20F3N5O/c22-21(23,24)16-11-14(19-15-5-9-27-20(15)29-18(12-25)28-19)1-2-17(16)30-10-6-13-3-7-26-8-4-13/h1-2,5,9,11,13,26H,3-4,6-8,10H2,(H,27,28,29)
Standard InChI Key: XLPMIJONDGGFEF-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
6.5005 0.4438 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.4978 -0.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5359 -1.3582 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.5383 -0.1583 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4870 -5.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7840 -6.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7795 -7.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0747 -8.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0672 -9.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7644 -10.5165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4691 -9.7600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4767 -8.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 4.2008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 14 1 0
7 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 20 1 0
28 24 2 0
22 29 1 0
29 30 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.42Molecular Weight (Monoisotopic): 415.1620AlogP: 4.28#Rotatable Bonds: 5Polar Surface Area: 86.62Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.73CX Basic pKa: 10.29CX LogP: 4.20CX LogD: 1.38Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -0.73
References 1. (2016) Nitrogen-containing bicyclic aromatic heterocyclic compound,