US9340517, 242

ID: ALA3984103

PubChem CID: 57854076

Max Phase: Preclinical

Molecular Formula: C33H37N5O2S

Molecular Weight: 567.76

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCCC[C@@H]1N[C@H](CNC(=O)c2csc(-c3ccccc3)n2)CCN(CC(c2ccccc2)c2ccccc2)C1=O

Standard InChI:  InChI=1S/C33H37N5O2S/c34-19-10-17-29-33(40)38(22-28(24-11-4-1-5-12-24)25-13-6-2-7-14-25)20-18-27(36-29)21-35-31(39)30-23-41-32(37-30)26-15-8-3-9-16-26/h1-9,11-16,23,27-29,36H,10,17-22,34H2,(H,35,39)/t27-,29-/m0/s1

Standard InChI Key:  WZRHDCPARKBLRT-YTMVLYRLSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  1  0  0  0  0  0999 V2000
    6.4491    0.9354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6342    0.0546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1703    0.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1510   -0.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0030    3.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039    3.9799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3069    5.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2687    6.0825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6077    6.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7507    7.7097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2190    8.0165    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.9645    6.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9570    5.6036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4565    6.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4270    7.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9018    7.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4022    6.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4278    4.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9530    5.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4048   -2.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9016   -3.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5555   -4.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0513   -4.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7022   -5.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8572   -7.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614   -6.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7106   -5.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7448   -1.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2411   -1.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0822   -0.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4272    0.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9311    0.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0899   -0.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2707   -2.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  1  1
  5  6  1  0
  6  7  1  0
  7  8  1  1
  8  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 12  1  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  7 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 27 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 25 40  1  0
 40  5  1  0
 40 41  2  0
M  END

Associated Targets(Human)

MC5R Tchem Melanocortin receptor 5 (4283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 567.76Molecular Weight (Monoisotopic): 567.2668AlogP: 4.67#Rotatable Bonds: 11
Polar Surface Area: 100.35Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.90CX LogP: 4.32CX LogD: 1.61
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -0.53

References

1.  (2016)  Methods of modulating the activity of the MC5 receptor and treatment of conditions related to this receptor, 

Source

Source(1):