The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 2-(3-(((1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(3-(hydroxy(1-propylcyclobutyl)methyl)phenyl)cyclopentyl)methyl)phenoxy)acetate ID: ALA3984132
PubChem CID: 58681363
Max Phase: Preclinical
Molecular Formula: C29H37ClO5
Molecular Weight: 501.06
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC1(C(O)c2cccc([C@@H]3[C@@H](Cc4cccc(OCC(=O)OC)c4)[C@H](Cl)C[C@H]3O)c2)CCC1
Standard InChI: InChI=1S/C29H37ClO5/c1-3-11-29(12-6-13-29)28(33)21-9-5-8-20(16-21)27-23(24(30)17-25(27)31)15-19-7-4-10-22(14-19)35-18-26(32)34-2/h4-5,7-10,14,16,23-25,27-28,31,33H,3,6,11-13,15,17-18H2,1-2H3/t23-,24+,25+,27+,28?/m0/s1
Standard InChI Key: KVYBNNFCMIKGKE-OPEUHZMVSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
17.4276 -23.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7177 -23.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1222 -24.3238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8321 -23.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5497 -21.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3668 -21.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6212 -20.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9583 -20.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2995 -20.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9570 -19.3278 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.0685 -22.0643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8464 -22.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5101 -22.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9889 -23.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8026 -23.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1352 -22.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6543 -21.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9477 -22.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2783 -21.8014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2421 -23.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7240 -23.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5365 -23.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3988 -20.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5698 -19.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3487 -19.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5199 -18.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9130 -17.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1322 -18.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9647 -19.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5238 -17.6925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6920 -16.8928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0835 -16.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2517 -15.5476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3068 -16.6014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6432 -15.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 1 1
5 11 1 6
6 12 1 1
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 1 1 0
18 19 1 0
1 20 1 0
20 21 1 0
21 22 1 0
7 23 1 6
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.06Molecular Weight (Monoisotopic): 500.2330AlogP: 5.56#Rotatable Bonds: 10Polar Surface Area: 75.99Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.95CX Basic pKa: ┄CX LogP: 5.42CX LogD: 5.42Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: 0.73
References 1. (2010) Therapeutic compounds,