US9238658, 41

ID: ALA3984159

PubChem CID: 89626931

Max Phase: Preclinical

Molecular Formula: C23H26FN3O3

Molecular Weight: 411.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1cccc(NC(=O)N2CCC(N3CCc4ccc(F)cc43)CC2)c1

Standard InChI:  InChI=1S/C23H26FN3O3/c1-2-30-22(28)17-4-3-5-19(14-17)25-23(29)26-11-9-20(10-12-26)27-13-8-16-6-7-18(24)15-21(16)27/h3-7,14-15,20H,2,8-13H2,1H3,(H,25,29)

Standard InChI Key:  OROSDPGIEXRTFT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -3.8992  -13.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0513  -13.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4092  -12.1639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8501  -11.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7166  -12.5743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2080  -10.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6475   -9.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0022   -8.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9173   -7.3716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4777   -7.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3902   -6.7589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9504   -7.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6687   -8.3492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8628   -6.1485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4233   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3384   -5.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6928   -4.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1327   -3.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2175   -4.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1231   -9.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 20  1  0
 29 23  1  0
 10 30  2  0
 30  6  1  0
M  END

Associated Targets(non-human)

Scd1 Acyl-CoA desaturase 1 (506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 411.48Molecular Weight (Monoisotopic): 411.1958AlogP: 4.06#Rotatable Bonds: 4
Polar Surface Area: 61.88Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.00CX Basic pKa: 2.68CX LogP: 3.79CX LogD: 3.79
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.77Np Likeness Score: -1.56

References

1.  (2016)  Substituted piperidinyl-carboxamide derivatives useful as SCD 1 inhibitors, 

Source

Source(1):