The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9145392, 294 ID: ALA3984164
PubChem CID: 89450737
Max Phase: Preclinical
Molecular Formula: C26H36FN7O
Molecular Weight: 481.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(-c2cn(CCN(C)C)c(C3CCN(c4ncnc(N)c4OC(C)C)CC3)n2)ccc1F
Standard InChI: InChI=1S/C26H36FN7O/c1-17(2)35-23-24(28)29-16-30-26(23)33-10-8-19(9-11-33)25-31-22(15-34(25)13-12-32(4)5)20-6-7-21(27)18(3)14-20/h6-7,14-17,19H,8-13H2,1-5H3,(H2,28,29,30)
Standard InChI Key: GOPVGMUVSGFICI-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
3.6331 -3.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0072 -7.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2234 -8.3576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7644 -9.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7356 -9.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2036 -8.3653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6274 -7.8989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7458 -8.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1720 -8.4324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.0663 -9.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4183 -7.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6504 -10.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1446 -10.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9365 -12.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2292 -13.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8627 -14.5632 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.7300 -13.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1642 -14.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9381 -12.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 5 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 12 1 0
15 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
20 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
31 33 1 0
33 34 1 0
33 35 2 0
35 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.62Molecular Weight (Monoisotopic): 481.2965AlogP: 4.10#Rotatable Bonds: 8Polar Surface Area: 85.33Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.91CX LogP: 4.34CX LogD: 2.68Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.52Np Likeness Score: -1.44
References 1. (2015) Imidazole amines as modulators of kinase activity,