The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,4-dichlorophenyl)-6-(methyloxy)-7-({[5-(1-methylpiperidin-2-yl)-1,2,4-oxadiazol-3-yl]methyl}oxy)quinazolin-4-amine ID: ALA3984168
PubChem CID: 57802803
Max Phase: Preclinical
Molecular Formula: C24H24Cl2N6O3
Molecular Weight: 515.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cc1OCc1noc(C2CCCCN2C)n1
Standard InChI: InChI=1S/C24H24Cl2N6O3/c1-32-8-4-3-5-19(32)24-30-22(31-35-24)12-34-21-11-18-15(10-20(21)33-2)23(28-13-27-18)29-14-6-7-16(25)17(26)9-14/h6-7,9-11,13,19H,3-5,8,12H2,1-2H3,(H,27,28,29)
Standard InChI Key: SUWHOJVHZNVYPL-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
32.5223 -10.6055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2319 -10.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2291 -9.3734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5205 -8.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8142 -10.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8165 -9.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1106 -8.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4019 -9.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4036 -10.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1101 -10.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6941 -8.9688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6940 -8.1516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6968 -10.6085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5170 -8.1510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2230 -7.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9319 -8.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6374 -7.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6343 -6.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9199 -6.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2173 -6.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3397 -6.5048 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
35.3466 -8.1413 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.6988 -11.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9920 -11.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2416 -11.5077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6962 -12.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1065 -12.8231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9054 -12.6512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8827 -12.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5500 -11.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7408 -11.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2584 -11.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5912 -12.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4063 -12.6978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7397 -13.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
8 11 1 0
11 12 1 0
9 13 1 0
4 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
17 22 1 0
13 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 24 2 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
26 29 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.40Molecular Weight (Monoisotopic): 514.1287AlogP: 5.81#Rotatable Bonds: 7Polar Surface Area: 98.43Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.58CX LogP: 5.09CX LogD: 5.03Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.39
References 1. (2009) Receptor-type kinase modulators and methods of use,