N-(3,4-dichlorophenyl)-6-(methyloxy)-7-({[5-(1-methylpiperidin-2-yl)-1,2,4-oxadiazol-3-yl]methyl}oxy)quinazolin-4-amine

ID: ALA3984168

PubChem CID: 57802803

Max Phase: Preclinical

Molecular Formula: C24H24Cl2N6O3

Molecular Weight: 515.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cc1OCc1noc(C2CCCCN2C)n1

Standard InChI:  InChI=1S/C24H24Cl2N6O3/c1-32-8-4-3-5-19(32)24-30-22(31-35-24)12-34-21-11-18-15(10-20(21)33-2)23(28-13-27-18)29-14-6-7-16(25)17(26)9-14/h6-7,9-11,13,19H,3-5,8,12H2,1-2H3,(H,27,28,29)

Standard InChI Key:  SUWHOJVHZNVYPL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   32.5223  -10.6055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2319  -10.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2291   -9.3734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5205   -8.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8142  -10.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8165   -9.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1106   -8.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4019   -9.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4036  -10.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1101  -10.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6941   -8.9688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6940   -8.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6968  -10.6085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5170   -8.1510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2230   -7.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9319   -8.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6374   -7.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6343   -6.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9199   -6.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2173   -6.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3397   -6.5048    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.3466   -8.1413    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   29.6988  -11.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9920  -11.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2416  -11.5077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6962  -12.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1065  -12.8231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.9054  -12.6512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8827  -12.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5500  -11.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7408  -11.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2584  -11.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5912  -12.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4063  -12.6978    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7397  -13.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  8 11  1  0
 11 12  1  0
  9 13  1  0
  4 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 17 22  1  0
 13 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 24  2  0
 29 30  1  0
 29 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 26 29  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

EPHB4 Tchem Ephrin type-B receptor 4 (3198 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 515.40Molecular Weight (Monoisotopic): 514.1287AlogP: 5.81#Rotatable Bonds: 7
Polar Surface Area: 98.43Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.58CX LogP: 5.09CX LogD: 5.03
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.39

References

1.  (2009)  Receptor-type kinase modulators and methods of use, 

Source