The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9150544, 13 ID: ALA3984182
PubChem CID: 71626747
Max Phase: Preclinical
Molecular Formula: C24H30N6O6S2
Molecular Weight: 562.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)[C@@H](Cc1cc2ccnc(N)c2cc1OC)N1CC[C@H](NS(=O)(=O)c2cnc(N(C)C)s2)C1=O
Standard InChI: InChI=1S/C24H30N6O6S2/c1-5-36-23(32)18(11-15-10-14-6-8-26-21(25)16(14)12-19(15)35-4)30-9-7-17(22(30)31)28-38(33,34)20-13-27-24(37-20)29(2)3/h6,8,10,12-13,17-18,28H,5,7,9,11H2,1-4H3,(H2,25,26)/t17-,18+/m0/s1
Standard InChI Key: SKBXNVFZPUDRNW-ZWKOTPCHSA-N
Molfile:
RDKit 2D
38 41 0 0 1 0 0 0 0 0999 V2000
1.5446 3.5993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5857 3.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5914 1.5017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8934 0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9306 1.3589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6373 0.9000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0432 -3.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5487 -0.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5577 -1.9755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8141 -3.2782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4329 -4.6426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9265 -4.7901 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.6254 -3.8147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4313 -3.6970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5464 -6.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7964 -7.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8078 -8.5489 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1738 -7.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0067 -6.4386 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.4780 -8.6667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5122 -8.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4885 -9.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3453 -2.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4527 -3.7754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 6
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
14 16 2 0
16 10 1 0
16 17 1 0
17 18 2 0
18 8 1 0
18 19 1 0
19 20 1 0
6 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 6
25 26 1 0
26 27 2 0
26 28 2 0
26 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 1 0
32 34 1 0
34 35 1 0
34 36 1 0
24 37 1 0
37 21 1 0
37 38 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.67Molecular Weight (Monoisotopic): 562.1668AlogP: 1.40#Rotatable Bonds: 10Polar Surface Area: 157.05Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.73CX Basic pKa: 7.14CX LogP: 1.10CX LogD: 1.02Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.35Np Likeness Score: -0.74
References 1. (2015) Sulphonylaminopyrrolidinone derivatives, their preparation and their therapeutic application,