The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,4-dichlorophenyl)-6-(methyloxy)-7-{[(5-{[(phenylmethyl)oxy]methyl}-1,2,4-oxadiazol-3-yl)methyl]oxy}quinazolin-4-amine ID: ALA3984213
PubChem CID: 134156787
Max Phase: Preclinical
Molecular Formula: C26H21Cl2N5O4
Molecular Weight: 538.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cc1OCc1nc(COCc2ccccc2)no1
Standard InChI: InChI=1S/C26H21Cl2N5O4/c1-34-22-10-18-21(29-15-30-26(18)31-17-7-8-19(27)20(28)9-17)11-23(22)36-14-25-32-24(33-37-25)13-35-12-16-5-3-2-4-6-16/h2-11,15H,12-14H2,1H3,(H,29,30,31)
Standard InChI Key: FGQMTFNXIHXUTF-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
34.9161 -8.2282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6257 -7.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6229 -6.9961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9143 -6.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2080 -7.8193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2103 -7.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5044 -6.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7957 -7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7974 -7.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5039 -8.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0879 -6.5915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0878 -5.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0906 -8.2312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9108 -5.7737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6167 -5.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3257 -5.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0311 -5.3582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0281 -4.5401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3137 -4.1347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6111 -4.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7335 -4.1275 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
37.7404 -5.7641 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.3820 -7.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6752 -8.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9293 -7.9054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3839 -8.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7942 -9.2208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5931 -9.0488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5710 -8.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0922 -9.0927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2793 -9.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8005 -9.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9885 -9.5829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5099 -10.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8440 -10.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6614 -11.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1364 -10.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
8 11 1 0
11 12 1 0
9 13 1 0
4 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
17 22 1 0
13 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
26 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.39Molecular Weight (Monoisotopic): 537.0971AlogP: 6.37#Rotatable Bonds: 10Polar Surface Area: 104.42Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.59CX LogP: 5.73CX LogD: 5.73Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: -1.54
References 1. (2009) Receptor-type kinase modulators and methods of use,