US9340510, 2.032

ID: ALA3984243

PubChem CID: 118952234

Max Phase: Preclinical

Molecular Formula: C29H34N4O3S

Molecular Weight: 518.68

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1nc(C)c(C(=O)N[C@@H](C)c2ccc(CN3CCc4cc(OCC5CC5)ccc4C3)cc2)s1

Standard InChI:  InChI=1S/C29H34N4O3S/c1-18(30-28(35)27-19(2)31-29(37-27)32-20(3)34)23-8-6-21(7-9-23)15-33-13-12-24-14-26(11-10-25(24)16-33)36-17-22-4-5-22/h6-11,14,18,22H,4-5,12-13,15-17H2,1-3H3,(H,30,35)(H,31,32,34)/t18-/m0/s1

Standard InChI Key:  LXWCJIRMZANBLQ-SFHVURJKSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  1  0  0  0  0  0999 V2000
    1.5352   -8.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5775   -7.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8732   -8.2623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8660   -9.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8237  -10.3578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1616  -10.5206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5151   -9.9041    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.5150  -11.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0059  -10.8737    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8822  -12.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0763  -11.9733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3885  -13.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7606  -12.3187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2945  -12.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3952  -12.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5847   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8915   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1984    1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971    0.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7984    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2192    1.4475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4692    2.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2935   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2883   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8 13  2  0
 13 14  1  0
 14  6  2  0
 14 15  1  0
  2 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 29  1  0
 26 32  2  0
 32 33  1  0
 33 34  2  0
 34 24  1  0
 34 35  1  0
 35 21  1  0
 19 36  1  0
 36 37  2  0
 37 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3984243

    ---

Associated Targets(Human)

ACACB Tchem Acetyl-CoA carboxylase 2 (3474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.68Molecular Weight (Monoisotopic): 518.2352AlogP: 5.25#Rotatable Bonds: 9
Polar Surface Area: 83.56Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.20CX Basic pKa: 7.59CX LogP: 3.80CX LogD: 3.65
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.40Np Likeness Score: -1.72

References

1.  (2016)  Tetrahydroisoquinoline derivatives, pharmaceutical compositions and uses thereof, 

Source

Source(1):