The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340510, 2.032 ID: ALA3984243
PubChem CID: 118952234
Max Phase: Preclinical
Molecular Formula: C29H34N4O3S
Molecular Weight: 518.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1nc(C)c(C(=O)N[C@@H](C)c2ccc(CN3CCc4cc(OCC5CC5)ccc4C3)cc2)s1
Standard InChI: InChI=1S/C29H34N4O3S/c1-18(30-28(35)27-19(2)31-29(37-27)32-20(3)34)23-8-6-21(7-9-23)15-33-13-12-24-14-26(11-10-25(24)16-33)36-17-22-4-5-22/h6-11,14,18,22H,4-5,12-13,15-17H2,1-3H3,(H,30,35)(H,31,32,34)/t18-/m0/s1
Standard InChI Key: LXWCJIRMZANBLQ-SFHVURJKSA-N
Molfile:
RDKit 2D
37 41 0 0 1 0 0 0 0 0999 V2000
1.5352 -8.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5775 -7.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8732 -8.2623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8660 -9.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8237 -10.3578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1616 -10.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5151 -9.9041 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.5150 -11.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0059 -10.8737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8822 -12.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0763 -11.9733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3885 -13.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7606 -12.3187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2945 -12.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3952 -12.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8864 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1984 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 0.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7984 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2192 1.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4692 2.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
10 12 1 0
8 13 2 0
13 14 1 0
14 6 2 0
14 15 1 0
2 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 29 1 0
26 32 2 0
32 33 1 0
33 34 2 0
34 24 1 0
34 35 1 0
35 21 1 0
19 36 1 0
36 37 2 0
37 16 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.68Molecular Weight (Monoisotopic): 518.2352AlogP: 5.25#Rotatable Bonds: 9Polar Surface Area: 83.56Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.20CX Basic pKa: 7.59CX LogP: 3.80CX LogD: 3.65Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.40Np Likeness Score: -1.72
References 1. (2016) Tetrahydroisoquinoline derivatives, pharmaceutical compositions and uses thereof,