US9452990, 20

ID: ALA3984248

PubChem CID: 72709597

Max Phase: Preclinical

Molecular Formula: C24H25FN6O4

Molecular Weight: 480.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(N)nc(N3CCN(C(=O)c4cc5c(OC)cccc5[nH]4)CC3)nc2c(F)c1OC

Standard InChI:  InChI=1S/C24H25FN6O4/c1-33-17-6-4-5-15-13(17)11-16(27-15)23(32)30-7-9-31(10-8-30)24-28-20-14(22(26)29-24)12-18(34-2)21(35-3)19(20)25/h4-6,11-12,27H,7-10H2,1-3H3,(H2,26,28,29)

Standard InChI Key:  KVDIYQOAWIQMBE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0392    3.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0432   -3.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8978    3.7504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9003    5.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2005    5.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4984    5.2463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4960    3.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1957    2.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8008    5.9919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8048    7.1919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0983    5.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4528    5.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4501    4.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9501    4.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7098    6.0192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -14.9098    6.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.6935    3.4220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9369    2.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4370    2.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6936    3.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2287    3.7561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  5  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 14  3  1  0
 14 15  1  0
 15 16  1  0
  9 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 17  1  0
 20 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 27  1  0
 34 35  1  0
 35 25  1  0
M  END

Associated Targets(Human)

CFD Tchem Complement factor D (1353 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.50Molecular Weight (Monoisotopic): 480.1921AlogP: 2.82#Rotatable Bonds: 5
Polar Surface Area: 118.83Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.89CX LogP: 2.59CX LogD: 2.59
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -0.97

References

1.  (2016)  Complement pathway modulators and uses thereof, 

Source

Source(1):