The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9169205, 2.59 ID: ALA3984286
PubChem CID: 118473242
Max Phase: Preclinical
Molecular Formula: C25H29N3O3
Molecular Weight: 419.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(OC2CC2)ccc1N1CC[C@@H](Oc2ccc([C@H](C)NC(=O)CC#N)cc2)C1
Standard InChI: InChI=1S/C25H29N3O3/c1-17-15-22(30-21-7-8-21)9-10-24(17)28-14-12-23(16-28)31-20-5-3-19(4-6-20)18(2)27-25(29)11-13-26/h3-6,9-10,15,18,21,23H,7-8,11-12,14,16H2,1-2H3,(H,27,29)/t18-,23+/m0/s1
Standard InChI Key: KZGPGJZTTCGNQC-FDDCHVKYSA-N
Molfile:
RDKit 2D
31 34 0 0 1 0 0 0 0 0999 V2000
2.5958 -2.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1978 -1.5065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1958 -2.7065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7977 -1.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8362 -2.1122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2526 1.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2524 0.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4979 -1.0529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0317 -0.7359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1035 -2.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1243 -3.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6247 -4.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0995 -5.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6030 -6.6662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0790 -6.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1329 -7.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4014 -6.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0739 -4.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5736 -2.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3529 -1.7854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 3 0
2 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
14 13 1 1
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 24 1 0
22 27 1 0
27 28 2 0
28 19 1 0
28 29 1 0
12 30 1 0
30 31 2 0
31 9 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.53Molecular Weight (Monoisotopic): 419.2209AlogP: 4.28#Rotatable Bonds: 8Polar Surface Area: 74.59Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.17CX Basic pKa: 3.51CX LogP: 3.81CX LogD: 3.80Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.69Np Likeness Score: -1.14
References 1. (2015) Pyrrolidine derivatives, pharmaceutical compositions and uses thereof,