The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[3-(5-(1H-1,2,4-Triazol-3-yl)(1H-Indazol-3-yl))Phenyl-N-(2-Piperidylethyl)Carboxamide ID: ALA3984337
PubChem CID: 20789097
Max Phase: Preclinical
Molecular Formula: C23H25N7O
Molecular Weight: 415.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCN1CCCCC1)c1cccc(-c2n[nH]c3ccc(-c4nc[nH]n4)cc23)c1
Standard InChI: InChI=1S/C23H25N7O/c31-23(24-9-12-30-10-2-1-3-11-30)18-6-4-5-16(13-18)21-19-14-17(22-25-15-26-29-22)7-8-20(19)27-28-21/h4-8,13-15H,1-3,9-12H2,(H,24,31)(H,27,28)(H,25,26,29)
Standard InChI Key: ZZFQRNTYSZXOBJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
13.5916 -8.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5900 -9.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3010 -9.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2983 -8.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0083 -8.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0114 -9.3490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7981 -9.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2768 -8.9288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7905 -8.2663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0557 -10.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8844 -9.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5086 -10.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7656 -11.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5699 -11.9332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1166 -11.3156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8566 -10.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1398 -9.4412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5958 -10.0500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0067 -10.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8047 -10.5828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9174 -11.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1767 -12.2535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4589 -10.8665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1996 -10.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7411 -9.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4818 -8.7046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0252 -8.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7689 -7.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9686 -7.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4250 -7.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6817 -8.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
7 10 1 0
2 11 1 0
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 10 1 0
11 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
20 11 1 0
15 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.50Molecular Weight (Monoisotopic): 415.2121AlogP: 3.23#Rotatable Bonds: 6Polar Surface Area: 102.59Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.52CX Basic pKa: 8.16CX LogP: 3.22CX LogD: 2.37Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -1.80
References 1. (2002) Indazole derivatives as JNK inhibitors and compositions and methods related thereto,