US9255090, 110

ID: ALA3984341

PubChem CID: 71611276

Max Phase: Preclinical

Molecular Formula: C28H26FNO4

Molecular Weight: 459.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CC(=O)O)cc1-c1ccc(F)c2c1CN(C(=O)C1Cc3ccccc3C1)CC2

Standard InChI:  InChI=1S/C28H26FNO4/c1-34-26-9-6-17(13-27(31)32)12-23(26)21-7-8-25(29)22-10-11-30(16-24(21)22)28(33)20-14-18-4-2-3-5-19(18)15-20/h2-9,12,20H,10-11,13-16H2,1H3,(H,31,32)

Standard InChI Key:  IFGDBYCMXBYXNL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    4.9456    1.3452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9046    0.7483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8888   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5868   -5.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5825   -7.1998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5496   -5.3964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2959   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3341   -5.8527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0049   -5.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1479   -7.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6155   -7.7861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3700   -9.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8700   -9.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6155   -7.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8610   -6.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3610   -6.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3541   -5.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
  6 11  1  0
 11 12  2  0
 12  3  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 13  1  0
 23 18  2  0
 21 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 33 34  1  0
 34 26  1  0
M  END

Associated Targets(Human)

PTGDR2 Tchem G protein-coupled receptor 44 (4688 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.52Molecular Weight (Monoisotopic): 459.1846AlogP: 4.43#Rotatable Bonds: 5
Polar Surface Area: 66.84Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.19CX Basic pKa: CX LogP: 4.88CX LogD: 1.84
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -0.52

References

1.  (2016)  Heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators, 

Source

Source(1):