The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9255090, 110 ID: ALA3984341
PubChem CID: 71611276
Max Phase: Preclinical
Molecular Formula: C28H26FNO4
Molecular Weight: 459.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC(=O)O)cc1-c1ccc(F)c2c1CN(C(=O)C1Cc3ccccc3C1)CC2
Standard InChI: InChI=1S/C28H26FNO4/c1-34-26-9-6-17(13-27(31)32)12-23(26)21-7-8-25(29)22-10-11-30(16-24(21)22)28(33)20-14-18-4-2-3-5-19(18)15-20/h2-9,12,20H,10-11,13-16H2,1H3,(H,31,32)
Standard InChI Key: IFGDBYCMXBYXNL-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.9456 1.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9046 0.7483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8888 -5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5868 -5.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5825 -7.1998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5496 -5.3964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2959 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3341 -5.8527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0049 -5.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1479 -7.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6155 -7.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3700 -9.0825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8700 -9.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6155 -7.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8610 -6.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3610 -6.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3541 -5.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
6 11 1 0
11 12 2 0
12 3 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 13 1 0
23 18 2 0
21 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
33 34 1 0
34 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.52Molecular Weight (Monoisotopic): 459.1846AlogP: 4.43#Rotatable Bonds: 5Polar Surface Area: 66.84Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.19CX Basic pKa: ┄CX LogP: 4.88CX LogD: 1.84Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -0.52
References 1. (2016) Heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators,