US9340510, 1.028

ID: ALA3984471

PubChem CID: 118940253

Max Phase: Preclinical

Molecular Formula: C21H24F2N2O

Molecular Weight: 358.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)NC(C)c1ccc(CN2CCc3cc(C(F)F)ccc3C2)cc1

Standard InChI:  InChI=1S/C21H24F2N2O/c1-14(24-15(2)26)17-5-3-16(4-6-17)12-25-10-9-18-11-19(21(22)23)7-8-20(18)13-25/h3-8,11,14,21H,9-10,12-13H2,1-2H3,(H,24,26)

Standard InChI Key:  NMECNOZATIAAIB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    3.6126   -8.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5765   -7.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2731   -8.2489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2648   -9.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2226  -10.3446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3009  -10.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5847   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8915   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1984    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2368    0.8962    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2005    2.6977    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2935   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2883   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 20 21  1  0
 21 12  1  0
 17 22  1  0
 22 23  1  0
 22 24  1  0
 10 25  1  0
 25 26  2  0
 26  7  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3984471

    ---

Associated Targets(Human)

ACACB Tchem Acetyl-CoA carboxylase 2 (3474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 358.43Molecular Weight (Monoisotopic): 358.1857AlogP: 4.38#Rotatable Bonds: 5
Polar Surface Area: 32.34Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.05CX LogP: 3.43CX LogD: 2.69
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.86Np Likeness Score: -1.23

References

1.  (2016)  Tetrahydroisoquinoline derivatives, pharmaceutical compositions and uses thereof, 

Source

Source(1):