The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9328118, 23 ID: ALA3984479
PubChem CID: 117914023
Max Phase: Preclinical
Molecular Formula: C26H28F3N5O2
Molecular Weight: 499.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1nc(-c2ccc(OCCC3CCNCC3)c(C(F)(F)F)c2)c2ccn(CC3CCOC3)c2n1
Standard InChI: InChI=1S/C26H28F3N5O2/c27-26(28,29)21-13-19(1-2-22(21)36-12-7-17-3-8-31-9-4-17)24-20-5-10-34(15-18-6-11-35-16-18)25(20)33-23(14-30)32-24/h1-2,5,10,13,17-18,31H,3-4,6-9,11-12,15-16H2
Standard InChI Key: NBKBYLWQEXRZJJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
6.5005 0.4438 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.4978 -0.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5359 -1.3582 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.5383 -0.1583 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4870 -5.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7840 -6.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7795 -7.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0747 -8.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0672 -9.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7644 -10.5165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4691 -9.7600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4767 -8.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8794 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8823 -2.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3600 -2.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9656 -3.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8476 -4.7650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5510 -4.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 4.2008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 14 1 0
7 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
22 35 1 0
35 36 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.54Molecular Weight (Monoisotopic): 499.2195AlogP: 4.79#Rotatable Bonds: 7Polar Surface Area: 84.99Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.36CX LogP: 4.40CX LogD: 1.58Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.50Np Likeness Score: -0.83
References 1. (2016) Nitrogen-containing bicyclic aromatic heterocyclic compound,