US9340510, 2.007

ID: ALA3984544

PubChem CID: 118940325

Max Phase: Preclinical

Molecular Formula: C23H25F3N2O

Molecular Weight: 402.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)C1CC1)c1ccc(CN2CCc3c(cccc3C(F)(F)F)C2)cc1

Standard InChI:  InChI=1S/C23H25F3N2O/c1-15(27-22(29)18-9-10-18)17-7-5-16(6-8-17)13-28-12-11-20-19(14-28)3-2-4-21(20)23(24,25)26/h2-8,15,18H,9-14H2,1H3,(H,27,29)/t15-/m0/s1

Standard InChI Key:  IDQMKMDRELUJBL-HNNXBMFYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  1  0  0  0  0  0999 V2000
    1.5352   -8.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5775   -7.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8732   -8.2623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8660   -9.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8237  -10.3578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1616  -10.5206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8283  -11.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5826  -10.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5847   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8915   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6369    3.6015    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5587    3.6005    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5975    4.2008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2935   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2883   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  6  1  0
  2  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 14  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 12 28  1  0
 28 29  2  0
 29  9  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3984544

    ---

Associated Targets(Human)

ACACB Tchem Acetyl-CoA carboxylase 2 (3474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.46Molecular Weight (Monoisotopic): 402.1919AlogP: 4.85#Rotatable Bonds: 5
Polar Surface Area: 32.34Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.01CX LogP: 4.70CX LogD: 4.55
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.78Np Likeness Score: -1.47

References

1.  (2016)  Tetrahydroisoquinoline derivatives, pharmaceutical compositions and uses thereof, 

Source

Source(1):