The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9169270, 95 ID: ALA3984614
PubChem CID: 72948337
Max Phase: Preclinical
Molecular Formula: C20H17ClN4O5S
Molecular Weight: 460.90
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)COc1ccc(Cl)cc1C1c2scnc2CCN1C(=O)OCc1cnccn1
Standard InChI: InChI=1S/C20H17ClN4O5S/c21-12-1-2-16(29-10-17(26)27)14(7-12)18-19-15(24-11-31-19)3-6-25(18)20(28)30-9-13-8-22-4-5-23-13/h1-2,4-5,7-8,11,18H,3,6,9-10H2,(H,26,27)
Standard InChI Key: MHEUFHJWNNGDIQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
4.1749 3.5991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2121 2.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2532 3.5924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2066 1.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9046 0.7483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8924 -4.9525 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3114 -2.9665 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1876 6.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1824 7.5124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8807 8.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5843 7.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5895 6.0034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
9 11 1 0
11 12 2 0
12 6 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 13 1 0
21 17 2 0
14 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.90Molecular Weight (Monoisotopic): 460.0608AlogP: 3.33#Rotatable Bonds: 6Polar Surface Area: 114.74Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.61CX Basic pKa: 2.01CX LogP: 1.56CX LogD: -1.65Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -1.36
References 1. (2015) 1-phenyl-substituted heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators,