The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9133148, 11j ID: ALA3984658
PubChem CID: 89677635
Max Phase: Preclinical
Molecular Formula: C22H22F6N2O3
Molecular Weight: 476.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2ccccc2)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1
Standard InChI: InChI=1S/C22H22F6N2O3/c1-32-18-13-16(15-5-3-2-4-6-15)7-8-17(18)14-29-9-11-30(12-10-29)20(31)33-19(21(23,24)25)22(26,27)28/h2-8,13,19H,9-12,14H2,1H3
Standard InChI Key: NYTNOLBYMNWIKI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 -5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -5.2404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9020 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6004 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2111 -5.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2173 -7.1837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5072 -5.2269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8111 -5.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1071 -5.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1497 -5.8077 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-10.1431 -4.6079 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-9.1009 -4.0134 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.8158 -7.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7788 -8.0749 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.8201 -8.6710 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-8.8571 -8.0674 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 10 1 0
13 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
19 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
5 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.42Molecular Weight (Monoisotopic): 476.1535AlogP: 5.11#Rotatable Bonds: 5Polar Surface Area: 42.01Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.39CX LogP: 5.07CX LogD: 5.03Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -0.81
References 1. (2015) Carbamate compounds and of making and using same,