US9133148, 11j

ID: ALA3984658

PubChem CID: 89677635

Max Phase: Preclinical

Molecular Formula: C22H22F6N2O3

Molecular Weight: 476.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(-c2ccccc2)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1

Standard InChI:  InChI=1S/C22H22F6N2O3/c1-32-18-13-16(15-5-3-2-4-6-15)7-8-17(18)14-29-9-11-30(12-10-29)20(31)33-19(21(23,24)25)22(26,27)28/h2-8,13,19H,9-12,14H2,1H3

Standard InChI Key:  NYTNOLBYMNWIKI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3092   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6108   -5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9072   -5.2404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9020   -3.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6004   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2111   -5.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2173   -7.1837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5072   -5.2269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8111   -5.9702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1071   -5.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1497   -5.8077    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1431   -4.6079    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1009   -4.0134    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8158   -7.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7788   -8.0749    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8201   -8.6710    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8571   -8.0674    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2978    3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2954    5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0048    6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3026    5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3002    3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 10  1  0
 13 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 19 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
  5 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Associated Targets(non-human)

Faah Anandamide amidohydrolase (476 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 476.42Molecular Weight (Monoisotopic): 476.1535AlogP: 5.11#Rotatable Bonds: 5
Polar Surface Area: 42.01Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.39CX LogP: 5.07CX LogD: 5.03
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -0.81

References

1.  (2015)  Carbamate compounds and of making and using same, 

Source

Source(1):