US9139568, 39

ID: ALA3984688

PubChem CID: 89651655

Max Phase: Preclinical

Molecular Formula: C22H24N4O

Molecular Weight: 360.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)c1ccc(NC(CN2CCCC2)c2ccccc2)c2cccnc12

Standard InChI:  InChI=1S/C22H24N4O/c23-22(27)18-10-11-19(17-9-6-12-24-21(17)18)25-20(15-26-13-4-5-14-26)16-7-2-1-3-8-16/h1-3,6-12,20,25H,4-5,13-15H2,(H2,23,27)

Standard InChI Key:  VAMKHDMXMWUETC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    2.6024   -2.6977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6387   -0.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5973    1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8933    3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8912    5.2578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1017    6.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6332    7.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1333    7.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6747    6.1134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2941    3.7520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2894    5.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0120    5.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3087    5.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3040    3.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0027    2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
  9 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27  4  1  0
 27 22  1  0
M  END

Associated Targets(Human)

RPS6KB1 Tchem Ribosomal protein S6 kinase 1 (4456 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 360.46Molecular Weight (Monoisotopic): 360.1950AlogP: 3.58#Rotatable Bonds: 6
Polar Surface Area: 71.25Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.36CX LogP: 2.66CX LogD: 0.71
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.70Np Likeness Score: -1.09

References

1.  (2015)  Heterocyclic carboxamides as modulators of kinase activity, 

Source

Source(1):