US9169270, 91

ID: ALA3984755

PubChem CID: 72949064

Max Phase: Preclinical

Molecular Formula: C23H25ClN4O5S

Molecular Weight: 505.00

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCn1nc(C)cc1CCOC(=O)N1CCc2ncsc2C1c1cc(Cl)ccc1OCC(=O)O

Standard InChI:  InChI=1S/C23H25ClN4O5S/c1-3-28-16(10-14(2)26-28)7-9-32-23(31)27-8-6-18-22(34-13-25-18)21(27)17-11-15(24)4-5-19(17)33-12-20(29)30/h4-5,10-11,13,21H,3,6-9,12H2,1-2H3,(H,29,30)

Standard InChI Key:  PMINVNCOEOUZNL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   10.5939    0.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4550    0.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1517   -0.8676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1554   -1.9824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4054   -3.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8935   -4.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9382   -2.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -1.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3428   -5.8472    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6004   -3.0073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8978   -3.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003   -3.0161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2377   -3.6192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2044   -1.8161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  5  7  1  0
  7  8  2  0
  8  3  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 17  2  0
 21 22  1  0
 22 14  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
M  END

Associated Targets(Human)

PTGDR2 Tchem G protein-coupled receptor 44 (4688 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.00Molecular Weight (Monoisotopic): 504.1234AlogP: 4.11#Rotatable Bonds: 8
Polar Surface Area: 106.78Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.70CX Basic pKa: 2.92CX LogP: 2.53CX LogD: -0.40
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -1.35

References

1.  (2015)  1-phenyl-substituted heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators, 

Source

Source(1):