The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9169270, 91 ID: ALA3984755
PubChem CID: 72949064
Max Phase: Preclinical
Molecular Formula: C23H25ClN4O5S
Molecular Weight: 505.00
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1nc(C)cc1CCOC(=O)N1CCc2ncsc2C1c1cc(Cl)ccc1OCC(=O)O
Standard InChI: InChI=1S/C23H25ClN4O5S/c1-3-28-16(10-14(2)26-28)7-9-32-23(31)27-8-6-18-22(34-13-25-18)21(27)17-11-15(24)4-5-19(17)33-12-20(29)30/h4-5,10-11,13,21H,3,6-9,12H2,1-2H3,(H,29,30)
Standard InChI Key: PMINVNCOEOUZNL-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
10.5939 0.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4550 0.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1517 -0.8676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1554 -1.9824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4054 -3.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8935 -4.3777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9382 -2.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3428 -5.8472 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6004 -3.0073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8978 -3.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 -3.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2377 -3.6192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2044 -1.8161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
5 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 17 2 0
21 22 1 0
22 14 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
25 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.00Molecular Weight (Monoisotopic): 504.1234AlogP: 4.11#Rotatable Bonds: 8Polar Surface Area: 106.78Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.70CX Basic pKa: 2.92CX LogP: 2.53CX LogD: -0.40Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -1.35
References 1. (2015) 1-phenyl-substituted heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators,