The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 7-((1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(3-(hydroxy(1-propylcyclobutyl)methyl)phenyl)cyclopentyl)hept-5-enoate ID: ALA3984757
PubChem CID: 11955213
Max Phase: Preclinical
Molecular Formula: C27H39ClO4
Molecular Weight: 463.06
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC1(C(O)c2cccc([C@@H]3[C@@H](C/C=C\CCCC(=O)OC)[C@H](Cl)C[C@H]3O)c2)CCC1
Standard InChI: InChI=1S/C27H39ClO4/c1-3-14-27(15-9-16-27)26(31)20-11-8-10-19(17-20)25-21(22(28)18-23(25)29)12-6-4-5-7-13-24(30)32-2/h4,6,8,10-11,17,21-23,25-26,29,31H,3,5,7,9,12-16,18H2,1-2H3/b6-4-/t21-,22+,23+,25+,26?/m0/s1
Standard InChI Key: AMSYNEAWRKZFHZ-UPBVYHFLSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
24.7039 -14.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9940 -15.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3985 -15.7928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1084 -15.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8260 -12.8729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6432 -12.8729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8975 -12.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2346 -11.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5758 -12.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2333 -10.7968 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.3448 -13.5334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1227 -13.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7864 -14.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2652 -14.9403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0789 -14.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4115 -14.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9306 -13.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6751 -11.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2816 -12.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0591 -12.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2302 -11.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0077 -11.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1787 -10.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9563 -10.0398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1273 -9.2407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5628 -10.5875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9048 -8.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2240 -14.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5546 -13.2704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5184 -14.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0003 -15.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8128 -15.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 1 1
5 11 1 6
6 12 1 1
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
7 18 1 6
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
16 28 1 0
28 1 1 0
28 29 1 0
1 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.06Molecular Weight (Monoisotopic): 462.2537AlogP: 6.05#Rotatable Bonds: 11Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.95CX Basic pKa: ┄CX LogP: 5.51CX LogD: 5.51Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.18Np Likeness Score: 1.44
References 1. (2010) Therapeutic compounds,