US9168248, 15

ID: ALA3984794

PubChem CID: 46871506

Max Phase: Preclinical

Molecular Formula: C19H17ClN6O5

Molecular Weight: 444.84

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)Cn1nnc(-c2cc(N3CCC4(CC3)CC(=O)c3c(Cl)cccc3O4)no2)n1

Standard InChI:  InChI=1S/C19H17ClN6O5/c20-11-2-1-3-13-17(11)12(27)9-19(30-13)4-6-25(7-5-19)15-8-14(31-23-15)18-21-24-26(22-18)10-16(28)29/h1-3,8H,4-7,9-10H2,(H,28,29)

Standard InChI Key:  FMUOWTCJDBKUJN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    2.1437   -7.9797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9671   -8.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6223  -10.0021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4274   -8.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8578   -7.0713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2725   -6.5725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2352   -5.0730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8092   -4.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9463   -5.8801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2010   -3.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9531   -1.9978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9511   -0.8815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343   -2.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1406    2.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6406    2.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2406    3.0882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3906    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8906    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4906    1.7892    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.6405   -0.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8905   -1.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3905   -1.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6405   -0.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1405   -0.5490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  2  0
 25 26  1  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 24  1  0
 30 31  1  0
 31 18  1  0
M  END

Associated Targets(Human)

SCD Tchem Acyl-CoA desaturase (1011 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.84Molecular Weight (Monoisotopic): 444.0949AlogP: 2.07#Rotatable Bonds: 4
Polar Surface Area: 136.47Molecular Species: ACIDHBA: 10HBD: 1
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.47CX Basic pKa: 0.08CX LogP: 2.26CX LogD: -1.16
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.59

References

1.  (2015)  Spiro compounds useful as inhibitors of stearoyl-coenzyme A delta-9 desaturase, 

Source

Source(1):